CAS 6831-16-9
:(-)-Aristolene
Description:
(-)-Aristolene, with the CAS number 6831-16-9, is a naturally occurring sesquiterpene hydrocarbon primarily derived from various plant sources, including certain species of the Aristolochia genus. This compound is characterized by its distinct bicyclic structure, which contributes to its unique chemical properties and potential biological activities. (-)-Aristolene is typically colorless to pale yellow in appearance and has a characteristic aromatic odor. It is insoluble in water but soluble in organic solvents such as ethanol and ether. The compound has been studied for its potential applications in perfumery and as a flavoring agent due to its pleasant scent. Additionally, (-)-Aristolene exhibits various biological activities, including antimicrobial and anti-inflammatory properties, making it of interest in pharmacological research. Its stereochemistry, specifically the presence of a chiral center, contributes to its specific interactions in biological systems. Overall, (-)-Aristolene represents a significant compound in both natural product chemistry and potential therapeutic applications.
Formula:C15H24
InChI:InChI=1S/C15H24/c1-10-6-5-7-11-8-9-12-13(14(12,2)3)15(10,11)4/h8,10,12-13H,5-7,9H2,1-4H3/t10-,12-,13+,15+/m1/s1
InChI key:InChIKey=FOBXOZMHEKILEY-PBOSXPJTSA-N
SMILES:C[C@@]12[C@]3([C@](C3(C)C)(CC=C1CCC[C@H]2C)[H])[H]
Synonyms:- 1H-Cyclopropa[a]naphthalene, 1a,2,4,5,6,7,7a,7b-octahydro-1,1,7,7a-tetramethyl-, (1aR,7R,7aR,7bS)-
- Aristolene
- Aristolone, deoxo-
- (-)-Aristolene
- 1H-Cyclopropa[a]naphthalene, 1a,2,4,5,6,7,7a,7b-octahydro-1,1,7,7a-tetramethyl-, [1aR-(1aα,7α,7aα,7bα)]-
- 1H-Cyclopropa[a]naphthalene, 1a,2,4,5,6,7,7a,7b-octahydro-1,1,7,7a-tetramethyl-, (1aR,7R,7aR,7bS)-(-)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Ref: 4Z-C-327003
Discontinued product
