CAS 6831-89-6
:1,5-diphenyl-1H-pyrazole
Description:
1,5-Diphenyl-1H-pyrazole is an organic compound characterized by its pyrazole ring structure, which is a five-membered ring containing two adjacent nitrogen atoms. This compound features two phenyl groups attached to the 1 and 5 positions of the pyrazole ring, contributing to its aromatic properties and potential for various chemical interactions. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. The presence of the phenyl groups enhances its stability and can influence its reactivity, making it of interest in various fields, including pharmaceuticals and agrochemicals. 1,5-Diphenyl-1H-pyrazole can participate in various chemical reactions, such as electrophilic substitutions and coordination with metal ions, which may lead to the development of new materials or catalysts. Additionally, its derivatives may possess biological activity, making it a subject of research in medicinal chemistry. Safety data should be consulted for handling and usage, as with any chemical substance.
Formula:C15H12N2
InChI:InChI=1/C15H12N2/c1-3-7-13(8-4-1)15-11-12-16-17(15)14-9-5-2-6-10-14/h1-12H
SMILES:c1ccc(cc1)c1ccnn1c1ccccc1
Synonyms:- 1,5-Diphenylpyrazole
- 1H-Pyrazole, 1,5-diphenyl-
- 6831-89-6
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
1,5-Diphenyl-1H-pyrazole
CAS:Formula:C15H12N2Purity:95%Color and Shape:SolidMolecular weight:220.26921,5-diphenyl-1H-pyrazole
CAS:1,5-diphenyl-1H-pyrazole is a nitro compound that binds to the guanine nucleotide binding protein. It is an inhibitor of cyclic nucleotide phosphodiesterase and has been shown to inhibit the growth of cryptococcus neoformans in vitro assays. 1,5-Diphenyl-1H-pyrazole has been synthesized by an asymmetric synthesis method. The molecular modeling and nmr spectra show that 1,5-diphenyl-1H-pyrazole has a pyrazole ring with a fluorine atom at the 5 position. The reaction products of this compound are not known; however, it does have an inhibitory effect on rat liver microsomes.Formula:C15H12N2Purity:Min. 95%Molecular weight:220.28 g/mol

