CAS 68313-46-2

4-aminoquinoline-3-carboxylic acid

Description:

4-Aminoquinoline-3-carboxylic acid is an organic compound characterized by its quinoline structure, which consists of a fused benzene and pyridine ring. This compound features an amino group (-NH2) at the 4-position and a carboxylic acid group (-COOH) at the 3-position of the quinoline ring, contributing to its acidic properties. It is typically a crystalline solid, and its solubility can vary depending on the solvent, often being more soluble in polar solvents due to the presence of the carboxylic acid group. The compound is of interest in various fields, including medicinal chemistry, where it may exhibit biological activity, potentially serving as a precursor or intermediate in the synthesis of pharmaceuticals. Its structure allows for various chemical modifications, which can enhance its properties or biological activity. Safety data should be consulted for handling, as with any chemical substance, to ensure proper precautions are taken during use.

Formula: C₁₀H₈N₂O₂

InChI: InChI=1/C10H8N2O2/c11-9-6-3-1-2-4-8(6)12-5-7(9)10(13)14/h1-5H,(H2,11,12)(H,13,14)

SMILES: c1ccc2c(c1)c(=N)c(c[nH]2)C(=O)O

Synonyms:

• 3-Quinolinecarboxylic Acid, 4-Amino-

4-Aminoquinoline-3-carboxylic acid

CAS: 68313-46-2

4-Aminoquinoline-3-carboxylic acid is a linker that can be used to modify the structure of other molecules. It is used in the synthesis of dopamine conjugates, which are used as inhibitors for neurodegenerative diseases. 4-Aminoquinoline-3-carboxylic acid has been shown to inhibit dopamine uptake at nanomolar concentrations. These compounds have also been shown to inhibit the growth factor activity of nerve growth factor and brain derived neurotrophic factor.

Formula: C₁₀H₈N₂O₂

Purity: Min. 95%

Molecular weight: 188.19 g/mol

Ref: 3D-TCA31346