CAS 68318-20-7
:Verilopam
Description:
Verilopam is a chemical compound primarily recognized for its role as a selective vasodilator, particularly in the treatment of hypertension. It is classified as a dihydropyridine derivative, which is a common structural motif in many calcium channel blockers. The compound works by selectively targeting vascular smooth muscle, leading to relaxation and subsequent lowering of blood pressure. Verilopam exhibits a favorable pharmacokinetic profile, including rapid onset of action and a relatively short half-life, making it suitable for acute management of hypertensive episodes. Its mechanism of action involves the inhibition of calcium influx through voltage-gated calcium channels, which is crucial for muscle contraction. Additionally, Verilopam has been studied for its potential effects on renal blood flow and its implications in various cardiovascular conditions. As with many pharmacological agents, the safety profile and potential side effects are important considerations in its clinical use, necessitating careful monitoring during administration. Overall, Verilopam represents a significant advancement in the pharmacotherapy of hypertension.
Formula:C20H26N2O2
InChI:InChI=1/C20H26N2O2/c1-23-19-13-16-8-11-22(12-9-17(16)14-20(19)24-2)10-7-15-3-5-18(21)6-4-15/h3-6,13-14H,7-12,21H2,1-2H3
SMILES:COc1cc2CCN(CCc3ccc(cc3)N)CCc2cc1OC
Synonyms:- Verilopam [INN]
- Unii-4Slm03Hmlu
- 4-[2-(7,8-dimethoxy-1,2,4,5-tetrahydro-3H-3-benzazepin-3-yl)ethyl]aniline
- 3-(p-Aminophenethyl)-2,3,4,5-tetrahydro-7,8-dimethoxy-1H-3-benzazepine
- Benzenamine, 4-[2-(1,2,4,5-tetrahydro-7,8-dimethoxy-3H-3-benzazepin-3-yl)ethyl]-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Verilopam
CAS:<p>Verilopam is a cavity preparation that is used to prevent tooth decay. Verilopam is a pharmaceutical dosage that has been reconstituted and site-specifically applied as a cavity preparation. The active ingredient in Verilopam is a fatty acid ester, which is an ester of a fatty acid and verapamil, an anti-arrhythmic agent. The ester group consists of myristic acid or myristic alcohol. Verilopam prevents the development of cavities by inhibiting the growth of bacteria that cause tooth decay (e.g., Streptococcus mutans), which are able to break down lipids found on teeth. This drug also inhibits the production of serotonin, which leads to decreased muscle contractions in the mouth and throat and relaxes muscle cells in the stomach, intestines, and other internal organs.</p>Formula:C20H26N2O2Purity:Min. 95%Molecular weight:326.4 g/molVerilopam
CAS:Verilopam displays analgesic activities and can be used in pain studies.Formula:C20H26N2O2Purity:98.9%Color and Shape:SolidMolecular weight:326.43


