CAS 68319-88-0
:N-Cyano-N′-(3,4-dimethoxyphenyl)urea
Description:
N-Cyano-N′-(3,4-dimethoxyphenyl)urea, with the CAS number 68319-88-0, is a chemical compound characterized by its urea functional group and a cyano substituent. This compound features a phenyl ring that is further substituted with two methoxy groups at the 3 and 4 positions, which can influence its solubility and reactivity. The presence of the cyano group contributes to its potential as a versatile building block in organic synthesis, particularly in the development of agrochemicals and pharmaceuticals. The methoxy groups enhance the electron-donating properties of the phenyl ring, which can affect the compound's interaction with biological targets. Additionally, the structural configuration may impart specific physical properties such as melting point and solubility in various solvents. Overall, N-Cyano-N′-(3,4-dimethoxyphenyl)urea is of interest in research for its potential applications in medicinal chemistry and material science.
Formula:C10H11N3O3
InChI:InChI=1S/C10H11N3O3/c1-15-8-4-3-7(5-9(8)16-2)13-10(14)12-6-11/h3-5H,1-2H3,(H2,12,13,14)
InChI key:InChIKey=WTZGVCFTMFVLQC-UHFFFAOYSA-N
SMILES:O(C)C1=C(OC)C=C(NC(NC#N)=O)C=C1
Synonyms:- N-Cyano-N′-(3,4-dimethoxyphenyl)urea
- Urea, N-cyano-N′-(3,4-dimethoxyphenyl)-
- 1-(3,4-Dimethoxyphenyl)-3-cyanourea
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
