CAS 6832-87-7
:2-Bromo-N-methylaniline
Description:
2-Bromo-N-methylaniline is an organic compound characterized by the presence of a bromine atom and a methyl group attached to the nitrogen of an aniline structure. It features a bromobenzene ring, where the bromine is positioned at the second carbon relative to the amino group. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and temperature. It is known for its moderate solubility in organic solvents and limited solubility in water due to the hydrophobic nature of the aromatic ring. 2-Bromo-N-methylaniline is utilized in various chemical syntheses, including the production of dyes, pharmaceuticals, and agrochemicals. It exhibits typical amine reactivity, such as nucleophilic substitution and electrophilic aromatic substitution, making it a versatile intermediate in organic synthesis. Safety precautions should be observed when handling this compound, as it may pose health risks, including skin and respiratory irritation. Proper storage in a cool, dry place away from incompatible substances is essential to maintain its stability and integrity.
Formula:C7H8BrN
InChI:InChI=1/C7H8BrN/c1-9-7-5-3-2-4-6(7)8/h2-5,9H,1H3
SMILES:CNc1ccccc1Br
Synonyms:- Benzenamine, 2-bromo-N-methyl-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-Bromo-N-methylaniline, 95%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci
Formula:C7H8BrNPurity:95%Molecular weight:186.05



