CAS 683219-73-0

β-[[(1,1-Dimethylethoxy)carbonyl]amino]-4-fluorobenzenebutanoic acid

Description:

β-[[(1,1-Dimethylethoxy)carbonyl]amino]-4-fluorobenzenebutanoic acid is a chemical compound characterized by its complex structure, which includes a fluorobenzene moiety and a butanoic acid chain. The presence of the 1,1-dimethylethoxycarbonyl group indicates that it has protective groups that can influence its reactivity and stability. This compound is likely to exhibit properties typical of amino acids, such as the ability to form hydrogen bonds and participate in various chemical reactions, including peptide bond formation. The fluorine atom in the para position of the benzene ring can enhance the compound's lipophilicity and may influence its biological activity. Additionally, the presence of the carboxylic acid functional group suggests that it can act as an acid, contributing to its solubility in polar solvents. Overall, this compound may have applications in medicinal chemistry or as an intermediate in the synthesis of more complex molecules, although specific applications would depend on its biological activity and reactivity profile.

Formula: C₁₅H₂₀FNO₄

InChI: InChI=1S/C15H20FNO4/c1-15(2,3)21-14(20)17-12(9-13(18)19)8-10-4-6-11(16)7-5-10/h4-7,12H,8-9H2,1-3H3,(H,17,20)(H,18,19)

InChI key: InChIKey=KEGMJLZICKHWIR-UHFFFAOYSA-N

SMILES: C(C(NC(OC(C)(C)C)=O)CC(O)=O)C1=CC=C(F)C=C1

Synonyms:

• β-[[(1,1-Dimethylethoxy)carbonyl]amino]-4-fluorobenzenebutanoic acid
• Benzenebutanoic acid, β-[[(1,1-dimethylethoxy)carbonyl]amino]-4-fluoro-
• 3-(Boc-amino)-4-(4-fluorophenyl)butyric Acid
• 4-(4-fluorophenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid