CAS 683219-85-4

3-{[(9H-fluoren-9-ylmethoxy)carbonyl]amino}heptanoic acid

Description:

3-{[(9H-fluoren-9-ylmethoxy)carbonyl]amino}heptanoic acid, commonly referred to as Fmoc-heptanoic acid, is a chemical compound characterized by its structure, which includes a heptanoic acid backbone modified with a fluorenylmethoxycarbonyl (Fmoc) protecting group. This compound is typically used in peptide synthesis as a protective group for amino acids, allowing for selective reactions without interfering with other functional groups. The Fmoc group is known for its stability under basic conditions and can be removed under mild acidic conditions, making it advantageous in synthetic protocols. The presence of the heptanoic acid moiety contributes to the compound's hydrophobic characteristics, influencing its solubility and interaction with other molecules. Additionally, the compound's molecular structure includes both hydrophilic and hydrophobic regions, which can affect its behavior in biological systems and its potential applications in drug development and materials science. Overall, Fmoc-heptanoic acid serves as a valuable intermediate in the synthesis of peptides and other complex organic molecules.

Formula: C₂₂H₂₅NO₄

InChI: InChI=1/C22H25NO4/c1-2-3-8-15(13-21(24)25)23-22(26)27-14-20-18-11-6-4-9-16(18)17-10-5-7-12-19(17)20/h4-7,9-12,15,20H,2-3,8,13-14H2,1H3,(H,23,26)(H,24,25)

SMILES: CCCCC(CC(=O)O)N=C(O)OCC1c2ccccc2c2ccccc12

Synonyms:

• Heptanoic acid, 3-[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]-
• 3-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}heptanoic acid

3-(9-H-Fluoren-9-ylmethoxycarbonylamino)-heptanoic acid

CAS: 683219-85-4

3-(9-H-Fluoren-9-ylmethoxycarbonylamino)-heptanoic acid

Purity: ≥95%

Molecular weight: 367.44g/mol

Ref: 54-OR307655