CAS 683219-94-5

γ-[[(9H-Fluoren-9-ylmethoxy)carbonyl]amino]benzenebutanoic acid

Description:

γ-[[(9H-Fluoren-9-ylmethoxy)carbonyl]amino]benzenebutanoic acid, commonly referred to as Fmoc-γ-ABA, is a synthetic compound primarily used in peptide synthesis and drug development. It features a fluorenylmethoxycarbonyl (Fmoc) protecting group, which is widely utilized in solid-phase peptide synthesis due to its stability under basic conditions and ease of removal under acidic conditions. The compound contains an amino acid structure with a γ-benzenebutanoic acid moiety, contributing to its potential applications in medicinal chemistry. Its molecular structure allows for the formation of peptide bonds, making it valuable in the construction of peptides and proteins. The presence of the Fmoc group enhances the solubility and stability of the compound in various solvents, facilitating its use in laboratory settings. Additionally, the compound's unique characteristics, such as its ability to participate in various chemical reactions, make it a versatile building block in organic synthesis and biochemistry. As with many synthetic compounds, safety and handling precautions should be observed due to potential hazards associated with its use.

Formula: C₂₅H₂₃NO₄

InChI: InChI=1S/C25H23NO4/c27-24(28)15-14-23(17-8-2-1-3-9-17)26-25(29)30-16-22-20-12-6-4-10-18(20)19-11-5-7-13-21(19)22/h1-13,22-23H,14-16H2,(H,26,29)(H,27,28)

InChI key: InChIKey=GVVBQAUUPFWYCV-UHFFFAOYSA-N

SMILES: C(OC(NC(CCC(O)=O)C1=CC=CC=C1)=O)C2C=3C(C=4C2=CC=CC4)=CC=CC3

Synonyms:

• Benzenebutanoic acid, γ-[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]-
• γ-[[(9H-Fluoren-9-ylmethoxy)carbonyl]amino]benzenebutanoic acid

4-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-4-phenylbutanoic acid

CAS: 683219-94-5

Versatile small molecule scaffold

Formula: C₂₅H₂₃NO₄

Purity: Min. 95%

Molecular weight: 401.5 g/mol

Ref: 3D-ICB21994