CAS 683220-64-6
:3-(1-amino-3-hydroxy-propyl)phenol
Description:
3-(1-Amino-3-hydroxy-propyl)phenol, identified by its CAS number 683220-64-6, is an organic compound characterized by the presence of a phenolic ring substituted with an amino group and a hydroxypropyl side chain. This compound typically exhibits properties associated with both phenols and amines, such as potential solubility in polar solvents due to the hydroxyl and amino functional groups. The amino group can participate in hydrogen bonding, enhancing its reactivity and interaction with other molecules. Additionally, the hydroxyl group contributes to its potential as a reducing agent and may influence its biological activity. The compound may be utilized in various applications, including pharmaceuticals, where it could serve as an intermediate in the synthesis of more complex molecules or as a potential therapeutic agent due to its structural features. Its stability, reactivity, and specific applications would depend on the surrounding conditions, such as pH and temperature, as well as the presence of other reactive species.
Formula:C9H13NO2
InChI:InChI=1/C9H13NO2/c10-9(4-5-11)7-2-1-3-8(12)6-7/h1-3,6,9,11-12H,4-5,10H2
SMILES:c1cc(cc(c1)O)C(CCO)N
Synonyms:- 3-(1-Amino-3-hydroxypropyl)phenol
- Benzenepropanol, γ-amino-3-hydroxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
