CAS 68323-30-8
:[2-(Bicyclo[2.2.1]hept-5-en-2-yl)ethyl](trimethoxy)silane
Description:
[2-(Bicyclo[2.2.1]hept-5-en-2-yl)ethyl](trimethoxy)silane, with the CAS number 68323-30-8, is an organosilicon compound characterized by the presence of a silane functional group attached to a bicyclic structure. This compound features a bicyclo[2.2.1]heptene moiety, which contributes to its unique reactivity and potential applications in organic synthesis and materials science. The trimethoxy groups enhance its solubility in organic solvents and facilitate its reactivity in condensation reactions, making it useful as a coupling agent or surface modifier. The presence of the bicyclic structure may impart interesting steric and electronic properties, influencing its behavior in polymerization processes or as a precursor for more complex silane derivatives. Additionally, this compound may exhibit hydrophobic characteristics due to the silane component, which can be advantageous in various applications, including coatings and sealants. Overall, its unique structure and functional groups make it a valuable compound in both research and industrial applications.
Formula:C12H22O3Si
InChI:InChI=1/C12H22O3Si/c1-13-16(14-2,15-3)7-6-12-9-10-4-5-11(12)8-10/h4-5,10-12H,6-9H2,1-3H3
SMILES:CO[Si](CCC1CC2C=CC1C2)(OC)OC
Synonyms:- Bicyclo[2.2.1]hept-2-ene, 5-[2-(trimethoxysilyl)ethyl]-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
(2-(Bicyclo[2.2.1]hept-5-en-2-yl)ethyl)trimethoxysilane
CAS:(2-(Bicyclo[2.2.1]hept-5-en-2-yl)ethyl)trimethoxysilanePurity:97%Molecular weight:242.39g/mol[(5-BICYCLO[2.2.1]HEPT-2-ENYL)ETHYL]TRIMETHOXYSILANE, tech, endo/exo isomers
CAS:<p>Olefin Functional Trialkoxy Silane<br>Silane coupling agents have the ability to form a durable bond between organic and inorganic materials to generate desired heterogeneous environments or to incorporate the bulk properties of different phases into a uniform composite structure. The general formula has two classes of functionality. The hydrolyzable group forms stable condensation products with siliceous surfaces and other oxides such as those of aluminum, zirconium, tin, titanium, and nickel. The organofunctional group alters the wetting or adhesion characteristics of the substrate, utilizes the substrate to catalyze chemical transformations at the heterogeneous interface, orders the interfacial region, or modifies its partition characteristics, and significantly effects the covalent bond between organic and inorganic materials.<br>[(5-Bicyclo[2.2.1]hept-2-enyl)ethyl]trimethoxysilane; (Norbornenyl)ethyltrimethoxysilane; Trimethoxysilylethylnorbornene<br>Endo/exo isomersUsed in microparticle surface modificationComonomer for polyolefin polymerization<br></p>Formula:C12H22O3SiPurity:92% endo/exo isomersColor and Shape:Straw LiquidMolecular weight:242.39[(Bicycloheptenyl)ethyl]trimethoxysilane
CAS:<p>S25058 - [(Bicycloheptenyl)ethyl]trimethoxysilane</p>Formula:C12H22O3SiColor and Shape:Liquid, Clear to straw liquidMolecular weight:242.39


