
CAS 68324-96-9
:Prosta-5,13,17-trien-1-oic acid, 6,9-epoxy-11,15-dihydroxy-, monosodium salt, (5Z,9α,11α,13E,15S,17Z)-
Description:
Prosta-5,13,17-trien-1-oic acid, 6,9-epoxy-11,15-dihydroxy-, monosodium salt, commonly referred to as a sodium salt of a prostaglandin derivative, is a bioactive compound with significant physiological effects. This substance is characterized by its complex molecular structure, which includes multiple functional groups such as hydroxyl (-OH) and carboxylic acid (-COOH) groups, contributing to its reactivity and biological activity. The presence of an epoxy group and the specific stereochemistry indicated by its nomenclature suggest that it may interact with various biological receptors, influencing processes such as inflammation, vascular tone, and smooth muscle contraction. As a sodium salt, it is likely to be more soluble in aqueous environments, enhancing its bioavailability for therapeutic applications. Prostaglandin derivatives are known for their roles in mediating physiological responses, making this compound of interest in pharmacology and medicinal chemistry. Its CAS number, 68324-96-9, allows for precise identification in chemical databases and regulatory contexts.
Formula:C20H30O5·Na
InChI:InChI=1S/C20H30O5.Na/c1-2-3-4-7-14(21)10-11-16-17-12-15(8-5-6-9-20(23)24)25-19(17)13-18(16)22;/h3-4,8,10-11,14,16-19,21-22H,2,5-7,9,12-13H2,1H3,(H,23,24);/b4-3-,11-10+,15-8-;/t14-,16+,17+,18+,19-;/m0./s1
InChI key:InChIKey=USYZXETWPDFDLF-YICKWJRGSA-N
SMILES:C(=C/[C@H](C/C=C\CC)O)\[C@@H]1[C@@]2([C@@](O/C(=C\CCCC(O)=O)/C2)(C[C@H]1O)[H])[H].[Na]
Synonyms:- Prosta-5,13,17-trien-1-oic acid, 6,9-epoxy-11,15-dihydroxy-, monosodium salt, (5Z,9α,11α,13E,15S,17Z)-
- 2H-Cyclopenta[b]furan, prosta-5,13,17-trien-1-oic acid deriv.
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Prostaglandin I3 (sodium salt)
CAS:<p>PGI3, made from EPA via COX, matches PGI2 in platelet/vascular effects, has a brief half-life, and breaks down into δ17-6-keto PGF1α.</p>Formula:C20H29NaO5Color and Shape:SolidMolecular weight:372.43
