CAS 683274-54-6

Methyl 3-iodobenzo[b]thiophene-2-carboxylate

Description:

Methyl 3-iodobenzo[b]thiophene-2-carboxylate is an organic compound characterized by its unique structure, which includes a thiophene ring fused to a benzene ring, along with a carboxylate ester functional group. The presence of the iodine atom at the 3-position of the benzo[b]thiophene moiety contributes to its reactivity and potential applications in organic synthesis and medicinal chemistry. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents such as dichloromethane or ethanol. Its molecular structure suggests potential for various chemical reactions, including nucleophilic substitutions and coupling reactions, making it a valuable intermediate in the synthesis of more complex molecules. Additionally, the compound may possess interesting electronic properties due to the conjugated system formed by the thiophene and benzene rings, which could be explored in materials science or as a precursor in the development of pharmaceuticals. Safety data should be consulted for handling, as iodine-containing compounds can pose health risks.

Formula: C₁₀H₇IO₂S

InChI: InChI=1S/C10H7IO2S/c1-13-10(12)9-8(11)6-4-2-3-5-7(6)14-9/h2-5H,1H3

InChI key: InChIKey=ONAZJXBGWCWHPN-UHFFFAOYSA-N

SMILES: IC=1C=2C(SC1C(OC)=O)=CC=CC2

Synonyms:

• Methyl 3-iodobenzothiophene-2-carboxylate
• Methyl 3-iodobenzo[b]thiophene-2-carboxylate
• Benzo[b]thiophene-2-carboxylic acid, 3-iodo-, methyl ester

Methyl 3-iodobenzo[b]thiophene-2-carboxylate

CAS: 683274-54-6

Formula: C₁₀H₇IO₂S

Purity: 95.0%

Color and Shape: Solid

Molecular weight: 318.13

Ref: 10-F017355