CymitQuimica logo

CAS 683274-81-9

:

2-Bromo-1-(5-ethyl-2-methoxy-3-nitrophenyl)ethanone

Description:
2-Bromo-1-(5-ethyl-2-methoxy-3-nitrophenyl)ethanone is an organic compound characterized by its complex structure, which includes a bromine atom, an ethanone functional group, and a substituted phenyl ring. The presence of the ethyl and methoxy groups, along with the nitro group on the phenyl ring, contributes to its unique chemical properties and reactivity. This compound is likely to exhibit moderate polarity due to the presence of the nitro and methoxy groups, which can influence its solubility in various solvents. The bromine atom may also impart specific reactivity, making it a potential candidate for further chemical transformations, such as nucleophilic substitution reactions. Additionally, the nitro group can enhance the compound's electrophilic character, making it useful in synthetic applications. Overall, 2-Bromo-1-(5-ethyl-2-methoxy-3-nitrophenyl)ethanone is a versatile compound with potential applications in organic synthesis and medicinal chemistry, although specific applications would depend on further research and exploration of its properties.
Formula:C11H12BrNO4
InChI:InChI=1S/C11H12BrNO4/c1-3-7-4-8(10(14)6-12)11(17-2)9(5-7)13(15)16/h4-5H,3,6H2,1-2H3
InChI key:InChIKey=DGAFBSVHUSPLJE-UHFFFAOYSA-N
SMILES:O(C)C1=C(C(CBr)=O)C=C(CC)C=C1N(=O)=O
Synonyms:
  • Ethanone, 2-bromo-1-(5-ethyl-2-methoxy-3-nitrophenyl)-
  • 2-Bromo-1-(5-ethyl-2-methoxy-3-nitrophenyl)ethanone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.