CymitQuimica logo

CAS 683274-82-0

:

2-Bromo-1-(5-fluoro-2-methoxy-3-nitrophenyl)ethanone

Description:
2-Bromo-1-(5-fluoro-2-methoxy-3-nitrophenyl)ethanone is an organic compound characterized by its complex structure, which includes a bromine atom, a fluorine atom, a methoxy group, and a nitro group attached to a phenyl ring. This compound features a ketone functional group, indicated by the ethanone moiety, which contributes to its reactivity and potential applications in organic synthesis. The presence of the nitro group typically enhances the compound's electrophilicity, making it useful in various chemical reactions, including nucleophilic substitutions. The methoxy group can influence the compound's solubility and polarity, while the bromine and fluorine atoms may impart unique electronic properties. Overall, this compound is of interest in medicinal chemistry and materials science, where its specific functional groups can be leveraged for the development of pharmaceuticals or advanced materials. Its CAS number, 683274-82-0, allows for easy identification and reference in chemical databases and literature.
Formula:C9H7BrFNO4
InChI:InChI=1S/C9H7BrFNO4/c1-16-9-6(8(13)4-10)2-5(11)3-7(9)12(14)15/h2-3H,4H2,1H3
InChI key:InChIKey=JMEIBLPWJJNUJW-UHFFFAOYSA-N
SMILES:O(C)C1=C(C(CBr)=O)C=C(F)C=C1N(=O)=O
Synonyms:
  • 2-Bromo-1-(5-fluoro-2-methoxy-3-nitrophenyl)ethanone
  • Ethanone, 2-bromo-1-(5-fluoro-2-methoxy-3-nitrophenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.