CAS 68341-09-3

Copper, [[2,2'-(1,2-dimethyl-1,2-ethanediylidene)bis[N-methylhydrazinecarbothio amidato-kN2,kS]](2-)]-, (SP-4-2)-

Description:

The chemical substance known as Copper, [[2,2'-(1,2-dimethyl-1,2-ethanediylidene)bis[N-methylhydrazinecarbothio amidato-kN2,kS]](2-)]-, (SP-4-2)-, with the CAS number 68341-09-3, is a coordination complex featuring copper as the central metal ion. This compound is characterized by its unique ligand structure, which includes a bis(N-methylhydrazinecarbothioamide) moiety that coordinates to the copper ion through nitrogen and sulfur atoms. The presence of the dimethyl-1,2-ethanediylidene bridge contributes to the overall stability and geometry of the complex. Such coordination compounds often exhibit interesting electronic properties and can display various oxidation states, influencing their reactivity and potential applications in fields like catalysis or materials science. Additionally, the specific arrangement of ligands around the copper center can lead to distinct magnetic and optical properties, making these types of complexes valuable for research in coordination chemistry and related disciplines.

Formula: C₈H₁₄CuN₆S₂

InChI: InChI=1S/C8H16N6S2.Cu/c1-5(11-13-7(15)9-3)6(2)12-14-8(16)10-4;/h1-4H3,(H2,9,13,15)(H2,10,14,16);/q;+2/p-2/b11-5+,12-6+;

InChI key: SBHDKYTVDCRMOE-JPAPVDFESA-L

SMILES: C/C(=N\NC(=NC)[S-])/C(=N/NC(=NC)[S-])/C.[Cu+2]

Synonyms:

• Cuam

Diacetyl-bis(4-methylthiosemicarbazonato) copperII

CAS: 68341-09-3

Diacetyl-bis(4-methylthiosemicarbazonato) copperII

Formula: C₈H₁₆CuN₆S₂

Purity: 95%

Molecular weight: 323.93

Ref: 54-IN13995

CuATSM

CAS: 68341-09-3

CuATSM is a hypoxia imaging tracer; copper complex; PET probe; used for ALS and Parkinson's disease research.

Formula: C₈H₁₄CuN₆S₂

Purity: 97.01%

Color and Shape: Black Solid

Molecular weight: 321.92

Ref: TM-T36499

Diacetyl-bis(4-methylthiosemicarbazonato) copperII

CAS: 68341-09-3

Purity: 95%

Ref: IN-DA00FG3O

Cu(ATSM)

CAS: 68341-09-3

(SP-4-2)-[[2,2'-(1,2-Dimethyl-1,2-ethanediylidene)bis[N-methylhydrazinecarbothioamidato-κN2,κS]](2-)]-copper

Formula: C₈H₁₄CuN₆S₂

Purity: 98%

Molecular weight: 321.91

Ref: IN-DG01262892

Cu-ATSM

Controlled Product

CAS: 68341-09-3

Formula: C₈H₁₄CuN₆S₂

Color and Shape: Neat

Molecular weight: 321.913

Ref: TR-C210010