CAS 68347-90-0

(6-methylimidazo[2,1-b][1,3]thiazol-3-yl)acetic acid

Description:

(6-Methylimidazo[2,1-b][1,3]thiazol-3-yl)acetic acid is a heterocyclic compound characterized by its complex structure, which includes an imidazole ring fused to a thiazole ring, along with an acetic acid functional group. This compound is notable for its potential biological activity, particularly in the context of mutagenicity and carcinogenicity, as it is derived from the class of compounds known to be formed during the cooking of certain foods. The presence of both nitrogen and sulfur atoms in its rings contributes to its unique chemical properties, influencing its reactivity and interactions with biological systems. The acetic acid moiety enhances its solubility in polar solvents, making it more bioavailable. Additionally, the methyl group at the 6-position of the imidazole ring can affect its electronic properties and steric hindrance, which may play a role in its biological interactions. Overall, this compound is of interest in both synthetic chemistry and toxicology, warranting further investigation into its effects and applications.

Formula: C₈H₈N₂O₂S

InChI: InChI=1/C8H8N2O2S/c1-5-3-10-6(2-7(11)12)4-13-8(10)9-5/h3-4H,2H2,1H3,(H,11,12)

SMILES: Cc1cn2c(CC(=O)O)csc2n1

2-(6-Methylimidazo[2,1-b]thiazol-3-yl)acetic acid

CAS: 68347-90-0

Formula: C₈H₈N₂O₂S

Molecular weight: 196.2263

Ref: IN-DA005R7V

2-{6-Methylimidazo[2,1-b][1,3]thiazol-3-yl}acetic acid

CAS: 68347-90-0

Versatile small molecule scaffold

Formula: C₈H₈N₂O₂S

Purity: Min. 95%

Molecular weight: 196.23 g/mol

Ref: 3D-TCA34790