CAS 68347-91-1

6-Phenylimidazo[2,1-b]thiazole-3-acetic acid

Description:

6-Phenylimidazo[2,1-b]thiazole-3-acetic acid is a heterocyclic compound characterized by its imidazo-thiazole core structure, which incorporates both nitrogen and sulfur atoms. This compound features a phenyl group attached to the imidazole ring, contributing to its aromatic properties. The presence of the acetic acid functional group enhances its solubility in polar solvents and may influence its biological activity. Typically, compounds of this nature are studied for their potential pharmacological properties, including anti-inflammatory and anticancer activities. The molecular structure allows for various interactions with biological targets, making it of interest in medicinal chemistry. Additionally, the compound's stability, reactivity, and solubility can vary based on environmental conditions such as pH and temperature. As with many heterocycles, the electronic properties of the nitrogen and sulfur atoms can play a significant role in the compound's reactivity and interactions with other molecules. Overall, 6-Phenylimidazo[2,1-b]thiazole-3-acetic acid represents a class of compounds that may have significant implications in drug development and therapeutic applications.

Formula: C₁₃H₁₀N₂O₂S

InChI: InChI=1/C13H10N2O2S/c16-12(17)6-10-8-18-13-14-11(7-15(10)13)9-4-2-1-3-5-9/h1-5,7-8H,6H2,(H,16,17)

InChI key: InChIKey=ZBDXJNSQBIUHPE-UHFFFAOYSA-N

SMILES: C(C(O)=O)C=1N2C(=NC(=C2)C3=CC=CC=C3)SC1

Synonyms:

• (6-Phenyl-imidazo[2,1-b]thiazol-3-yl)-acetic acid
• 2-(6-Phenylimidazo[2,1-b]thiazol-3-yl)acetic acid
• 2-[6-Phenylimidazo[2,1-b][1,3]thiazol-3-yl]acetic acid
• 6-Phenylimidazo[2,1-b]thiazole-3-acetic acid
• Imidazo[2,1-B]Thiazole-3-Acetic Acid, 6-Phenyl-

2-{6-Phenylimidazo[2,1-b][1,3]thiazol-3-yl}acetic acid

CAS: 68347-91-1

Versatile small molecule scaffold

Formula: C₁₃H₁₀N₂O₂S

Purity: Min. 95%

Molecular weight: 258.3 g/mol

Ref: 3D-TCA34791