CAS 68353-24-2

1-Methyl-2-nonyl-4(1H)-quinolone

Description:

1-Methyl-2-nonyl-4(1H)-quinolone, identified by its CAS number 68353-24-2, is a chemical compound belonging to the quinolone family, which is characterized by a bicyclic structure containing a fused benzene and pyridine ring. This compound typically exhibits properties such as being a pale yellow to brownish liquid or solid, depending on its purity and specific formulation. It is known for its potential applications in various fields, including pharmaceuticals and agrochemicals, due to its biological activity. The presence of the methyl and nonyl groups contributes to its hydrophobic characteristics, influencing its solubility and interaction with biological membranes. Additionally, quinolones are often recognized for their antimicrobial properties, making them significant in medicinal chemistry. However, specific safety and handling guidelines should be followed, as with all chemical substances, to mitigate any potential hazards associated with exposure or environmental impact.

Formula: C₁₉H₂₇NO

InChI: InChI=1S/C19H27NO/c1-3-4-5-6-7-8-9-12-16-15-19(21)17-13-10-11-14-18(17)20(16)2/h10-11,13-15H,3-9,12H2,1-2H3

InChI key: InChIKey=XIGBBPQAXHSVSN-UHFFFAOYSA-N

SMILES: CN1C=2C(C(=O)C=C1CCCCCCCCC)=CC=CC2

Synonyms:

• 1-Methyl-2-n-nonyl-4(1H) quinolone
• 1-Methyl-2-nonyl-4-quinolinone
• 1-Methyl-2-nonyl-4(1H)-quinolone
• 1-Methyl-2-nonyl-4(1H)-quinolinone
• 4(1H)-Quinolinone, 1-methyl-2-nonyl-

1-Methyl-2-nonylquinolin-4(1H)-one

CAS: 68353-24-2

Formula: C₁₉H₂₇NO

Purity: %

Color and Shape: Solid

Molecular weight: 285.4238

Ref: IN-DA00646H

1-Methyl-2-nonylquinolin-4(1H)-one

CAS: 68353-24-2

1-Methyl-2-nonylquinolin-4(1H)-one has anti-inflammatory activity, it exhibits inhibitory activity on leukotriene biosynthesis in a bioassay using human

Formula: C₁₉H₂₇NO

Purity: 98%

Color and Shape: Solid

Molecular weight: 285.42

Ref: TM-TN2552

1-Methyl-2-nonylquinolin-4(1H)-one

CAS: 68353-24-2

Formula: C₁₉H₂₇NO

Purity: 95%~99%

Molecular weight: 285.431

Ref: BP-SBP03195

1-Methyl-2-nonyl-4-quinolinone

CAS: 68353-24-2

1-Methyl-2-nonyl-4-quinolinone is a synthetic compound, classified as a quinolone derivative, which is derived from quinoline. This compound is known for its antifungal properties, specifically designed to manage fungal growth in various agricultural settings. It acts by inhibiting the synthesis of ergosterol, a crucial component of fungal cell membranes. This disruption in ergosterol production compromises the integrity of the fungal cell membrane, leading to cell lysis and ultimately ceasing fungal proliferation.

Formula: C₁₉H₂₇NO

Purity: Min. 95%

Molecular weight: 285.4 g/mol

Ref: 3D-TCA35324