CAS 68359-57-9

4-Fluoro-3-phenoxybenzaldehyde

Description:

4-Fluoro-3-phenoxybenzaldehyde is an organic compound characterized by its aromatic structure, which includes a fluorine atom and a phenoxy group attached to a benzaldehyde moiety. The presence of the fluorine atom typically enhances the compound's reactivity and can influence its electronic properties, making it useful in various chemical applications. The phenoxy group contributes to the compound's hydrophobic characteristics, while the aldehyde functional group (-CHO) is known for its reactivity in condensation and oxidation reactions. This compound is often utilized in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals, due to its ability to serve as an intermediate in the synthesis of more complex molecules. Its physical properties, such as melting point, boiling point, and solubility, can vary based on the specific conditions and purity of the substance. Safety data should be consulted, as with any chemical, to ensure proper handling and usage in laboratory or industrial settings.

Formula: C₁₃H₉FO₂

InChI: InChI=1S/C13H9FO2/c14-12-7-6-10(9-15)8-13(12)16-11-4-2-1-3-5-11/h1-9H

InChI key: InChIKey=JDICMOLUAHZVDS-UHFFFAOYSA-N

SMILES: O(C1=CC(C=O)=CC=C1F)C2=CC=CC=C2

Synonyms:

• 3-(Phenoxy)-4-fluoro-benzaldehyde
• 3-Phenoxy-4-fluorobenzaldehyde
• Benzaldehyde, 4-fluoro-3-phenoxy-
• Fpba
• p-Fluoro-m-Phenoxybenzaldehyde
• 4-Fluoro-3-phenoxybenzaldehyde

4-Fluoro-3-phenoxybenzaldehyde

CAS: 68359-57-9

Formula: C₁₃H₉FO₂

Purity: 95%

Color and Shape: Liquid

Molecular weight: 216.2078

Ref: IN-DA006LVM

4-Fluoro-3-phenoxybenzaldehyde

CAS: 68359-57-9

4-Fluoro-3-phenoxybenzaldehyde

Formula: C₁₃H₉FO₂

Purity: 98%

Color and Shape: clear. faint greenish yellow liquid

Molecular weight: 216.21g/mol

Ref: 54-PC4157

4-Fluoro-3-phenoxybenzaldehyde

CAS: 68359-57-9

4-Fluoro-3-phenoxybenzaldehyde is a chiral organic compound that has been synthesized in the laboratory. This compound has a linear response to peroxide and can be used as an environmental pollutant indicator. It is produced by the reaction of phenol with peroxide in deionized water, which is catalyzed by acid. The reaction time is dependent on the diluent used, and ultrasonic irradiation can be used to speed up the reaction. 4-Fluoro-3-phenoxybenzaldehyde's structure consists of two isomers, each containing either a fluorine atom or hydrogen atom on one of the phenyl rings. 4-Fluoro-3-phenoxybenzaldehyde can be purified using distillation or recrystallization techniques.

Formula: C₁₃H₉FO₂

Purity: Min. 95%

Color and Shape: Liquid

Molecular weight: 216.21 g/mol

Ref: 3D-FF70884

4-Fluoro-3-phenoxybenzaldehyde

CAS: 68359-57-9

Formula: C₁₃H₉FO₂

Purity: 98%

Color and Shape: Liquid

Molecular weight: 216.211

Ref: 10-F210975