CymitQuimica logo

CAS 6836-97-1

:

3-Phenyl-2-pyrrolidinone

Description:
3-Phenyl-2-pyrrolidinone, with the CAS number 6836-97-1, is an organic compound characterized by its pyrrolidinone structure, which features a five-membered ring containing both nitrogen and a carbonyl group. This compound typically exhibits a white to off-white crystalline appearance and is soluble in organic solvents such as ethanol and acetone, but has limited solubility in water. The presence of the phenyl group contributes to its aromatic properties, influencing its reactivity and interactions in various chemical environments. 3-Phenyl-2-pyrrolidinone is often studied for its potential applications in pharmaceuticals and as an intermediate in organic synthesis. Its chemical properties, including its ability to participate in nucleophilic reactions, make it a valuable compound in medicinal chemistry. Additionally, it may exhibit biological activity, although specific pharmacological effects would depend on further research and context. As with many organic compounds, proper handling and safety measures should be observed due to potential toxicity or reactivity.
Formula:C10H11NO
InChI:InChI=1S/C10H11NO/c12-10-9(6-7-11-10)8-4-2-1-3-5-8/h1-5,9H,6-7H2,(H,11,12)
InChI key:InChIKey=BNWOFLCLCRHUTF-UHFFFAOYSA-N
SMILES:O=C1C(CCN1)C2=CC=CC=C2
Synonyms:
  • 3-Phenyl-2-pyrrolidone
  • 2-Pyrrolidinone, 3-phenyl-
  • 3-Phenyl-2-pyrrolidinone
  • 3-Phenyl-2-oxopyrrolidine
Found 4 products.