CAS 6836-99-3
:4-bromo-2-phenylbutanoic acid
Description:
4-Bromo-2-phenylbutanoic acid is an organic compound characterized by its structure, which includes a butanoic acid backbone with a bromine atom and a phenyl group attached to the second carbon. This compound typically appears as a white to off-white solid and is soluble in organic solvents, but its solubility in water is limited due to the hydrophobic nature of the phenyl group. The presence of the bromine atom introduces a halogen, which can influence the compound's reactivity and potential applications in organic synthesis. As a carboxylic acid, it exhibits acidic properties, allowing it to participate in various chemical reactions, such as esterification and amidation. Its unique structure makes it of interest in medicinal chemistry and materials science, where it may serve as a building block for more complex molecules. Safety data should be consulted for handling, as with all chemical substances, to ensure proper precautions are taken during use.
Formula:C10H11BrO2
InChI:InChI=1/C10H11BrO2/c11-7-6-9(10(12)13)8-4-2-1-3-5-8/h1-5,9H,6-7H2,(H,12,13)
InChI key:XUHOQWJGOZLWST-UHFFFAOYSA-N
SMILES:c1ccc(cc1)C(CCBr)C(=O)O
Synonyms:- Benzeneacetic Acid, Α-(2-Bromoethyl)-
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery