CAS 68370-47-8

(3aS,9R,9aS,9bS)-9-hydroxy-6,9-dimethyl-3-methylidene-3a,4,5,7,8,9,9a,9b-octahydroazuleno[4,5-b]furan-2(3H)-one

Description:

The chemical substance known as (3aS,9R,9aS,9bS)-9-hydroxy-6,9-dimethyl-3-methylidene-3a,4,5,7,8,9,9a,9b-octahydroazuleno[4,5-b]furan-2(3H)-one, with the CAS number 68370-47-8, is a complex organic compound characterized by its unique bicyclic structure that incorporates both furan and azulene moieties. This compound features multiple stereocenters, which contribute to its chiral nature and potentially influence its biological activity. The presence of hydroxyl and methylidene functional groups suggests that it may exhibit interesting reactivity and solubility properties. Additionally, the octahydro framework indicates that it is a saturated compound, which may affect its stability and interactions with other molecules. Such compounds are often studied for their potential applications in pharmaceuticals, natural products, and materials science due to their intricate structures and diverse functional groups. Understanding the specific characteristics, such as melting point, boiling point, and solubility, would require experimental data or literature references for precise information.

Formula: C₁₅H₂₀O₃

InChI: InChI=1S/C15H20O3/c1-8-4-5-11-9(2)14(16)18-13(11)12-10(8)6-7-15(12,3)17/h11-13,17H,2,4-7H2,1,3H3/t11-,12-,13-,15+/m0/s1

InChI key: InChIKey=RDJAFOWISVMOJY-PWNZVWSESA-N

SMILES: C[C@]1(O)[C@@]2([C@@]3([C@](C(=C)C(=O)O3)(CCC(C)=C2CC1)[H])[H])[H]

(3aS)-3aβ,4,5,7,8,9,9aβ,9bα-Octahydro-9β-hydroxy-6,9-dimethyl-3-methyleneazuleno[4,5-b]furan-2(3H)-one

CAS: 68370-47-8

Formula: C₁₅H₂₀O₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 248.3175

Ref: IN-DA00FC0J

Micheliolide

CAS: 68370-47-8

Micheliolide

Purity: ≥98%

Molecular weight: 248.32g/mol

Ref: 54-BUP12712

Micheliolide

CAS: 68370-47-8

Formula: C₁₅H₂₀O₃

Molecular weight: 248.32

Ref: 7W-GY4687

Micheliolide

CAS: 68370-47-8

Formula: C₁₅H₂₀O₃

Purity: 95%~99%

Molecular weight: 248.322

Ref: BP-BP3259

Micheliolide

CAS: 68370-47-8

Micheliolide(MCL) is a sesquiterpene lactone which inhibits various inflammatory response.

Formula: C₁₅H₂₀O₃

Purity: 98% - 99.37%

Color and Shape: Solid

Molecular weight: 248.32

Ref: TM-T5688

Micheliolide

Controlled Product

CAS: 68370-47-8

Applications Micheliolide, a sesquiterpene lactone is used in the inhibition of resistant acute leukemic cells. Selectively targets cancer stem and progenitor cells.
References Zhang, Q. et al.: J. Med. Chem., 55, 8757 (2012); Ding, Y. et al.: Bioorg. Med. Chem. Lett.,

Formula: C₃₂H₄₀O₆

Color and Shape: Neat

Molecular weight: 248.32

Ref: TR-M342365