CAS 68385-95-5
:2-Amino-3,5-dibromobenzonitrile
Description:
2-Amino-3,5-dibromobenzonitrile is an organic compound characterized by the presence of an amino group (-NH2), two bromine atoms, and a nitrile group (-C≡N) attached to a benzene ring. This compound features a substituted benzene structure, where the amino group is located at the 2-position, and the bromine atoms are at the 3 and 5 positions relative to the amino group. The presence of the nitrile group contributes to its reactivity and potential applications in organic synthesis. Typically, compounds like this exhibit moderate to high polarity due to the electronegative bromine and nitrile groups, which can influence their solubility in various solvents. Additionally, the amino group can participate in hydrogen bonding, affecting the compound's physical properties. 2-Amino-3,5-dibromobenzonitrile may be used in the synthesis of pharmaceuticals, agrochemicals, or as an intermediate in organic reactions. Safety data should be consulted for handling, as halogenated compounds can pose environmental and health risks.
Formula:C7H4Br2N2
InChI:InChI=1/C7H4Br2N2/c8-5-1-4(3-10)7(11)6(9)2-5/h1-2H,11H2
SMILES:c1c(C#N)c(c(cc1Br)Br)N
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-Amino-3,5-dibromobenzonitrile
CAS:Formula:C7H4Br2N2Purity:98%Color and Shape:SolidMolecular weight:275.92812-Amino-3,5-dibromobenzonitrile
CAS:2-Amino-3,5-dibromobenzonitrilePurity:96%Molecular weight:275.93g/mol2-Amino-3,5-dibromobenzonitrile
CAS:Formula:C7H4Br2N2Purity:97%Color and Shape:SolidMolecular weight:275.9312-Amino-3,5-dibromobenzonitrile
CAS:2-Amino-3,5-dibromobenzonitrile is an electrophile that is used to synthesize various boronic acid derivatives. It also inhibits butyrylcholinesterase and 2-aminobenzonitrile, enhancing the activity of organophosphorus cholinesterase inhibitors. 2-Amino-3,5-dibromobenzonitrile has been shown to react with nucleophiles at the alpha position to form a stable intermediate. This reaction has been shown to be reversible in aqueous solution. The compound has been evaluated as a potential chemotherapeutic agent against cancer cells in vitro.
Formula:C7H4Br2N2Purity:Min. 95%Molecular weight:275.93 g/mol



