CAS 68399-76-8
:4-Pyrimidinecarboxylic acid, 1,2,3,6-tetrahydro-2,6-dioxo-, zinc salt (2:1)
Description:
4-Pyrimidinecarboxylic acid, 1,2,3,6-tetrahydro-2,6-dioxo-, zinc salt (2:1) is a coordination compound that features a zinc ion complexed with a pyrimidine derivative. This compound typically exhibits characteristics associated with both organic and inorganic chemistry, including solubility in polar solvents and potential bioactivity due to its pyrimidine structure, which is known for its presence in various biological molecules. The zinc salt form suggests that it may have applications in catalysis or as a nutritional supplement, given zinc's essential role in biological systems. The presence of dioxo groups indicates potential reactivity and stability under certain conditions, while the tetrahydro configuration may influence its steric and electronic properties. Additionally, this compound may exhibit unique thermal and spectral properties, making it of interest in materials science and medicinal chemistry. Overall, its characteristics are influenced by the interplay between the organic pyrimidine framework and the inorganic zinc component, leading to diverse potential applications.
Formula:C5H4N2O4Zn
InChI:InChI=1S/C5H4N2O4.Zn/c8-3-1-2(4(9)10)6-5(11)7-3;/h1H,(H,9,10)(H2,6,7,8,11);
InChI key:InChIKey=GSCDMEHILVOYGH-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=CC(=O)NC(=O)N1.[Zn]
Synonyms:- 4-Pyrimidinecarboxylic acid, 1,2,3,6-tetrahydro-2,6-dioxo-, zinc salt (2:1)
- Zinc Orotate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Orotic acid zinc
CAS:Orotic acid zinc (Zinc Orotate) salt dihydrate is an intermediate product in pyrimidine synthesis.Formula:C10H6N4O8ZnPurity:99.13%Color and Shape:SolidMolecular weight:188.79Zinc orotate
CAS:Zinc orotate is a mineral supplement that contains elemental zinc in the form of an orotate salt. It is used to treat or prevent zinc deficiency and for the prevention and treatment of various conditions, such as liver lesions, antimicrobial agents, brain functions, and energy metabolism. Zinc is an essential mineral that is required for normal growth and development. Zinc also plays a role in maintaining healthy skin and hair. The physiological levels of zinc are 10-20 mg per day for adults. Zinc orotate provides 100% of the daily requirement (15 mg) in just one tablet.Formula:C10H6N4O8Zn·2H2OPurity:Min. 95%Color and Shape:White PowderMolecular weight:411.59 g/mol




