CAS 68399-78-0
:N-2-Hydroxyethylpiperazine-N′-2-hydroxypropanesulfonic acid
Description:
N-2-Hydroxyethylpiperazine-N′-2-hydroxypropanesulfonic acid, commonly referred to as HEPS, is a zwitterionic buffer widely used in biological and biochemical research. It is characterized by its ability to maintain a stable pH in aqueous solutions, making it particularly useful in various laboratory applications, including cell culture and enzyme assays. HEPS has a pKa value that allows it to effectively buffer physiological pH ranges, typically around neutral pH. The compound is soluble in water, which enhances its utility in biological systems. Its structure features a piperazine ring, which contributes to its stability and buffering capacity. Additionally, the presence of hydroxyethyl and hydroxypropanesulfonic acid groups provides it with unique properties that facilitate interactions with biomolecules. Due to its low toxicity and compatibility with biological systems, HEPS is favored in experiments involving living cells and proteins. Overall, its characteristics make it an essential tool in the fields of biochemistry and molecular biology.
Formula:C9H20N2O5S
InChI:InChI=1S/C9H20N2O5S/c12-6-5-10-1-3-11(4-2-10)7-9(13)8-17(14,15)16/h9,12-13H,1-8H2,(H,14,15,16)
InChI key:InChIKey=GIZQLVPDAOBAFN-UHFFFAOYSA-N
SMILES:C(C(CS(=O)(=O)O)O)N1CCN(CCO)CC1
Synonyms:- 1-Piperazinepropanesulfonic acid, β-hydroxy-4-(2-hydroxyethyl)-
- 2-Hydroxy-3-(4-(2-hydroxyethyl)piperazin-1-yl)propane-1-sulfonicacid
- 2-Hydroxy-3-[4-(2-Hydroxyethyl)Piperazin-1-Yl]Propane-1-Sulfonic Acid
- 4-(2-Hydroxyethyl)piperazine-1-(2-hydroxy propanesulfonic acid)
- 4-(2-Hydroxyethyl)piperazine-1-(2-hydroxypropane-3-sulfonic acid)
- HEPPSO N-(2-Hydroxyethyl)piperazine-N-2-hydroxypropanesulfonic acid
- Heppso
- N-(Hydroxyethyl)piperazine-N'-2-hydroxypropanesulfonic acid
- N-2-Hydroxyethylpiperazine-N′-2-hydroxypropanesulfonic acid
- NSC 374113
- β-Hydroxy-4-(2-hydroxyethyl)-1-piperazinepropanesulfonic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
N-(2-Hydroxyethyl)piperazine-N'-2-hydroxypropanesulphonic acid
CAS:N-(2-Hydroxyethyl)piperazine-N'-2-hydroxypropanesulphonic acidFormula:C9H20N2O5SPurity:>98%Color and Shape: solidMolecular weight:268.33g/mol4-(2-Hydroxyethyl)piperazine-1-(2-hydroxypropane-3-sulfonic Acid) [Good's buffer component for biological research]
CAS:Formula:C9H20N2O5SPurity:>98.0%(T)Color and Shape:White to Almost white powder to crystalMolecular weight:268.33HEPPSO
CAS:HEPPSO is an amphoteric ion buffer pH 7.1-8.5, strong binding affinity for copper(II) ions.Formula:C9H20N2O5SColor and Shape:SolidMolecular weight:268.33HEPPSO
CAS:Formula:C9H20N2O5SPurity:≥ 98.0%Color and Shape:White to off-white powder or crystalsMolecular weight:268.33 (anhydrous)2-HYDROXY-3-[4-(2-HYDROXYETHYL)-1-PIPERAZINYL]PROPANE-1-SULFONIC ACID
CAS:Purity:98%Molecular weight:268.3299866HEPPSO
CAS:HEPPSO is a piperazinic buffer with an optimal pH range of 7.1-8.5 and a pKa of 7.84. It is an ampholytic separator, and can bind copper ions.
Formula:C9H20N2O5S·xH2OPurity:Min. 95%Color and Shape:PowderMolecular weight:268.33 g/mol





