CAS 6840-20-6

3-bromo-5,7-dimethylimidazo[1,2-a]pyrimidine

Description:

3-Bromo-5,7-dimethylimidazo[1,2-a]pyrimidine is a heterocyclic organic compound characterized by its fused imidazole and pyrimidine rings, which contribute to its unique chemical properties. The presence of bromine at the 3-position and methyl groups at the 5 and 7 positions enhances its reactivity and influences its biological activity. This compound is of interest in the field of medicinal chemistry and toxicology, particularly due to its potential mutagenic properties, which have been studied in relation to food safety and carcinogenicity. It is typically synthesized through specific organic reactions involving halogenation and alkylation processes. The compound is relatively stable under standard conditions but may undergo reactions typical of aromatic compounds, such as electrophilic substitution. Its solubility and behavior in various solvents can vary, making it important to consider in experimental applications. Overall, 3-bromo-5,7-dimethylimidazo[1,2-a]pyrimidine serves as a valuable compound for research in chemical biology and environmental studies.

Formula: C₈H₈BrN₃

InChI: InChI=1/C8H8BrN3/c1-5-3-6(2)12-7(9)4-10-8(12)11-5/h3-4H,1-2H3

SMILES: Cc1cc(C)n2c(cnc2n1)Br

3-Bromo-5,7-dimethylimidazo[1,2-a]pyrimidine

CAS: 6840-20-6

3-Bromo-5,7-dimethylimidazo[1,2-a]pyrimidine

Purity: ≥95%

Molecular weight: 226.07g/mol

Ref: 54-OR2601