CAS 6840-45-5

3-Bromoimidazo[1,2-a]pyrimidine

Description:

3-Bromoimidazo[1,2-a]pyrimidine is a heterocyclic organic compound characterized by its fused imidazole and pyrimidine rings, with a bromine substituent at the 3-position of the imidazole ring. This compound typically exhibits a pale yellow to off-white crystalline appearance. It is known for its potential biological activity, particularly in medicinal chemistry, where it may serve as a scaffold for the development of pharmaceuticals, especially in the context of targeting specific enzymes or receptors. The presence of the bromine atom can enhance its reactivity and influence its interaction with biological targets. Additionally, 3-Bromoimidazo[1,2-a]pyrimidine is soluble in various organic solvents, which facilitates its use in synthetic applications. Its molecular structure contributes to its unique electronic properties, making it a subject of interest in research related to drug design and development. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₆H₄BrN₃

InChI: InChI=1/C6H4BrN3/c7-5-4-9-6-8-2-1-3-10(5)6/h1-4H

SMILES: c1cnc2ncc(Br)n2c1

Synonyms:

• N-(4-chloro-5-formyl-3-phenyl-1,3-thiazol-2(3H)-ylidene)-4-fluorobenzenesulfonamide

Imidazo[1,​2-​a]​pyrimidine, 3-​bromo-

CAS: 6840-45-5

Formula: C₆H₄BrN₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 198.0201

Ref: IN-DA003J4H

3-Bromoimidazo[1,2-a]pyrimidine

CAS: 6840-45-5

3-Bromoimidazo[1,2-a]pyrimidine

Formula: C₆H₄BrN₃

Purity: 98%

Color and Shape: light brown solid

Molecular weight: 198.02g/mol

Ref: 54-OR14190

3-Bromoimidazo[1,2-a]pyrimidine

CAS: 6840-45-5

Formula: C₆H₄BrN₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 198.023

Ref: 10-F037037