CAS 68406-27-9
:20-Glucoginsenoside Rf
Description:
20-Glucoginsenoside Rf is a saponin compound primarily derived from ginseng, a plant known for its medicinal properties. This compound is part of the ginsenoside family, which are triterpenoid saponins that contribute to the pharmacological effects of ginseng. Characteristically, 20-Glucoginsenoside Rf exhibits a complex structure with multiple sugar moieties attached to a steroid-like backbone, which influences its solubility and bioactivity. It is known for its potential health benefits, including anti-inflammatory, antioxidant, and neuroprotective effects. The compound interacts with various biological pathways, making it of interest in pharmacological research. Additionally, its stability and reactivity can be influenced by environmental factors such as pH and temperature. As with many natural products, the extraction and purification processes can affect its yield and purity, which are critical for both research and therapeutic applications. Overall, 20-Glucoginsenoside Rf represents a significant area of study within natural product chemistry and pharmacognosy.
Formula:C48H82O19
InChI:InChI=1S/C48H82O19/c1-21(2)10-9-13-48(8,67-42-38(61)35(58)32(55)26(19-50)64-42)22-11-15-46(6)30(22)23(52)16-28-45(5)14-12-29(53)44(3,4)40(45)24(17-47(28,46)7)62-43-39(36(59)33(56)27(20-51)65-43)66-41-37(60)34(57)31(54)25(18-49)63-41/h10,22-43,49-61H,9,11-20H2,1-8H3/t22-,23+,24-,25+,26+,27+,28+,29-,30-,31+,32+,33+,34-,35-,36-,37+,38+,39+,40-,41-,42-,43+,45+,46+,47+,48-/m0/s1
InChI key:InChIKey=FBFMBWCLBGQEBU-RXMALORBSA-N
SMILES:C[C@]12[C@@]([C@]3(C)[C@@]([C@@H](O[C@H]4[C@H](O[C@@H]5O[C@H](CO)[C@@H](O)[C@H](O)[C@H]5O)[C@@H](O)[C@H](O)[C@@H](CO)O4)C1)(C(C)(C)[C@@H](O)CC3)[H])(C[C@@H](O)[C@]6([C@@]2(C)CC[C@@]6([C@@](O[C@@H]7O[C@H](CO)[C@@H](O)[C@H](O)[C@H]7O)(CCC=C(C)C)C)[H])[H])[H]
Synonyms:- Dammarane, β-D-glucopyranoside deriv.
- 20-Glucoginsenoside Rf
- (3β,6α,12β)-20-(β-D-Glucopyranosyloxy)-3,12-dihydroxydammar-24-en-6-yl 2-O-β-D-glucopyranosyl-β-D-glucopyranoside
- β-D-Glucopyranoside, (3β,6α,12β)-20-(β-D-glucopyranosyloxy)-3,12-dihydroxydammar-24-en-6-yl 2-O-β-D-glucopyranosyl-
- 20-O-Glucoginsenoside Rf
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
20-O-Glucoginsenoside Rf
CAS:20-O-Glucoginsenoside Rf is a natural product extracted from Panax ginseng C. A. Mey.Formula:C48H82O19Purity:98% - 99.77%Color and Shape:SolidMolecular weight:963.1520-o-Glucoginsenoside rf
CAS:<p>20-O-Glucoginsenoside Rf is a rare ginsenoside, which is a type of saponin compound derived primarily from Panax ginseng, a plant renowned for its pharmacological properties. This compound is one of many ginsenosides found in ginseng, distinguished by its unique structure and function. It exerts its mode of action through modulation of various cellular pathways, potentially influencing cell proliferation and apoptosis, and exhibiting antioxidant properties. This is achieved mainly through interactions with key receptors and enzymes involved in cell signaling.</p>Formula:C48H82O19Purity:Min. 95%Molecular weight:963.20 g/mol



