CAS 68408-23-1

Benzen-2,4,6-d3-amine, 3-methyl-

Description:

Benzen-2,4,6-d3-amine, 3-methyl- (CAS 68408-23-1) is a deuterated derivative of an aromatic amine, specifically a substituted aniline. The presence of deuterium isotopes at the 2, 4, and 6 positions of the benzene ring indicates that this compound is used in studies requiring isotopic labeling, such as in NMR spectroscopy or metabolic tracing. The methyl group at the 3-position introduces steric hindrance and can influence the compound's reactivity and solubility. As an amine, it possesses basic properties and can participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. The compound's structure suggests potential applications in organic synthesis, pharmaceuticals, and materials science. Additionally, the presence of deuterium may enhance the stability and reduce the volatility of the compound compared to its non-deuterated counterparts. Safety and handling precautions should be observed, as with all amines, due to potential toxicity and reactivity.

Formula: C₇H₆D₃N

InChI: InChI=1S/C7H9N/c1-6-3-2-4-7(8)5-6/h2-5H,8H2,1H3/i3D,4D,5D

InChI key: InChIKey=JJYPMNFTHPTTDI-QGZYMEECSA-N

SMILES: CC1=C(C(N)=C(C=C1[2H])[2H])[2H]

Synonyms:

• Benzen-2,4,6-d3-amine, 3-methyl-

m-Toluidine-2,4,6-d3

CAS: 68408-23-1

Formula: CH₃C₆HD₃NH₂

Purity: 98 atom % D

Color and Shape: Colorless Yellow Liquid

Molecular weight: 110.09233

Ref: 3U-D5614

m-Toluidine-2,4,6-d3

Controlled Product

CAS: 68408-23-1

Formula: C₇D₃H₆N

Color and Shape: Dark Red

Molecular weight: 110.17

Ref: TR-M536227