CAS 684249-99-8

(3,5-dimethyl-1H-1,2,4-triazol-1-yl)acetic acid

Description:

(3,5-Dimethyl-1H-1,2,4-triazol-1-yl)acetic acid is a chemical compound characterized by its triazole ring structure, which contributes to its biological activity and potential applications in various fields, including pharmaceuticals and agriculture. The presence of two methyl groups at the 3 and 5 positions of the triazole ring enhances its lipophilicity and may influence its interaction with biological targets. The acetic acid functional group provides acidity and can participate in hydrogen bonding, which is crucial for its solubility and reactivity. This compound may exhibit antifungal, antibacterial, or herbicidal properties, making it of interest in crop protection and medicinal chemistry. Its molecular structure allows for various synthetic modifications, potentially leading to derivatives with enhanced efficacy or reduced toxicity. As with many triazole derivatives, it is essential to consider its stability, solubility, and potential environmental impact when evaluating its practical applications. Overall, (3,5-dimethyl-1H-1,2,4-triazol-1-yl)acetic acid represents a versatile compound with significant research potential.

Formula: C₆H₉N₃O₂

InChI: InChI=1/C6H9N3O2/c1-4-7-5(2)9(8-4)3-6(10)11/h3H2,1-2H3,(H,10,11)

SMILES: Cc1nc(C)n(CC(=O)O)n1

Synonyms:

• 1H-1,2,4-triazole-1-acetic acid, 3,5-dimethyl-
• (3,5-Dimethyl-[1,2,4]triazol-1-yl)-acetic acid
• (3,5-Dimethyl-1H-1,2,4-triazol-1-yl)acetic acid

2-(3,5-Dimethyl-1H-1,2,4-triazol-1-yl)acetic acid

CAS: 684249-99-8

Formula: C₆H₉N₃O₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 155.1546

Ref: IN-DA006KA7

2-(3,5-Dimethyl-1H-1,2,4-triazol-1-yl)acetic acid

CAS: 684249-99-8

2-(3,5-Dimethyl-1H-1,2,4-triazol-1-yl)acetic acid

Purity: 95%

Molecular weight: 155.16g/mol

Ref: 54-OR1072596

(3,5-Dimethyl-[1,2,4]triazol-1-yl)-acetic acid

CAS: 684249-99-8

Formula: C₆H₉N₃O₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 155.157

Ref: 10-F059258