CAS 68429-53-8

2,4-Dimethylphenylacetonitrile

Description:

2,4-Dimethylphenylacetonitrile, with the CAS number 68429-53-8, is an organic compound characterized by its structure, which features a phenyl ring substituted with two methyl groups at the 2 and 4 positions, along with an acetonitrile functional group. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and temperature. It is known for its aromatic properties and is often utilized in organic synthesis and as an intermediate in the production of various chemicals. The presence of the nitrile group contributes to its reactivity, making it useful in nucleophilic addition reactions. Additionally, 2,4-Dimethylphenylacetonitrile may exhibit moderate toxicity, necessitating careful handling and appropriate safety measures during use. Its solubility characteristics can vary, but it is generally soluble in organic solvents while being less soluble in water. Overall, this compound is of interest in both industrial applications and research settings due to its unique structural features and reactivity.

Formula: C₁₀H₁₁N

InChI: InChI=1/C10H11N/c1-8-3-4-10(5-6-11)9(2)7-8/h3-4,7H,5H2,1-2H3

SMILES: Cc1ccc(CC#N)c(C)c1

2-(2,4-Dimethylphenyl)acetonitrile

CAS: 68429-53-8

Formula: C₁₀H₁₁N

Purity: 95%

Color and Shape: Liquid

Molecular weight: 145.2010

Ref: IN-DA006JUA

2,4-Dimethylphenylacetonitrile

CAS: 68429-53-8

2,4-Dimethylphenylacetonitrile

Molecular weight: 145.20104g/mol

Ref: 54-OR1021161

2,4-Dimethylphenylacetonitrile

CAS: 68429-53-8

Formula: C₁₀H₁₁N

Purity: 99.0%

Color and Shape: Liquid

Molecular weight: 145.205

Ref: 10-F135500