CymitQuimica logo

CAS 6843-36-3

:

2-(methylcarbamoyl)benzoic acid

Description:
2-(Methylcarbamoyl)benzoic acid, identified by its CAS number 6843-36-3, is an organic compound characterized by the presence of both a benzoic acid moiety and a methylcarbamoyl group. This compound typically exhibits properties associated with carboxylic acids, such as the ability to form hydrogen bonds, which can influence its solubility in polar solvents like water. The methylcarbamoyl group contributes to its potential as a weak acid, and it may participate in various chemical reactions, including esterification and amidation. The presence of the aromatic ring can also impart stability and influence the compound's reactivity. In terms of applications, derivatives of benzoic acid are often utilized in pharmaceuticals, agrochemicals, and as intermediates in organic synthesis. The specific characteristics, such as melting point, boiling point, and solubility, can vary based on the purity and specific formulation of the compound. Overall, 2-(methylcarbamoyl)benzoic acid is a versatile compound with potential utility in various chemical and industrial applications.
Formula:C9H9NO3
InChI:InChI=1/C9H9NO3/c1-10-8(11)6-4-2-3-5-7(6)9(12)13/h2-5H,1H3,(H,10,11)(H,12,13)
SMILES:CN=C(c1ccccc1C(=O)O)O
Synonyms:
  • Benzoic acid, 2-[(methylamino)carbonyl]-
  • 2-(Methylcarbamoyl)benzoic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.