CAS 6843-97-6
:Dodicin
Description:
Dodicin, with the CAS number 6843-97-6, is a chemical substance classified as a quaternary ammonium compound. It is primarily used as a surfactant and antimicrobial agent in various applications, including personal care products, household cleaners, and industrial formulations. Dodicin exhibits properties such as good solubility in water and effectiveness in reducing surface tension, which enhances its ability to emulsify and disperse other substances. Additionally, it possesses antimicrobial properties, making it effective against a range of bacteria and fungi, thus contributing to its use in disinfectants and preservatives. The compound is typically characterized by its cationic nature, which allows it to interact with negatively charged surfaces, enhancing its efficacy in cleaning and sanitizing applications. Safety data indicates that, like many quaternary ammonium compounds, Dodicin should be handled with care, as it may cause irritation to skin and eyes upon contact. Overall, Dodicin is valued for its multifunctional properties in both consumer and industrial products.
Formula:C18H39N3O2
InChI:InChI=1S/C18H39N3O2/c1-2-3-4-5-6-7-8-9-10-11-12-19-13-14-20-15-16-21-17-18(22)23/h19-21H,2-17H2,1H3,(H,22,23)
InChI key:InChIKey=FSKNXCHJIFBRBT-UHFFFAOYSA-N
SMILES:C(NCCCCCCCCCCCC)CNCCNCC(O)=O
Synonyms:- N-[2-[(2-Dodecylaminoethyl)amino]ethyl]glycine
- N-[2-[[2-(Dodecylamino)ethyl]amino]ethyl]glycine
- N-Lauryldiethylenetriaminoacetic acid
- Glycine, N-[2-[[2-(dodecylamino)ethyl]amino]ethyl]-
- Dodecylbis(aminoethyl)glycine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
