
CAS 68439-36-1
:D-Mannitol, ester with boric acid (H3BO3)
Description:
D-Mannitol, ester with boric acid, identified by CAS number 68439-36-1, is a chemical compound that combines the sugar alcohol D-mannitol with boric acid. This compound typically exhibits characteristics associated with both its components. D-mannitol is a white crystalline powder that is soluble in water and has a sweet taste, commonly used as a sugar substitute and in pharmaceutical formulations. The esterification with boric acid introduces boron into the structure, which can enhance its properties, such as stability and solubility in various solvents. This compound may also exhibit unique biological activities, making it of interest in medicinal chemistry and materials science. Additionally, the presence of boron can impart specific functionalities, such as potential applications in drug delivery systems or as a stabilizing agent in formulations. Overall, D-mannitol, ester with boric acid, represents a versatile compound with potential applications across various fields, including pharmaceuticals, food science, and materials development.
Formula:C6H14O6·xBH3O3
InChI:InChI=1S/C6H14O6.BH3O3/c7-1-3(9)5(11)6(12)4(10)2-8;2-1(3)4/h3-12H,1-2H2;2-4H/t3-,4-,5-,6-;/m1./s1
InChI key:InChIKey=KNNUSPFLQGAPAK-MVNLRXSJSA-N
SMILES:B(O)(O)O.[C@H]([C@@H]([C@@H](CO)O)O)([C@@H](CO)O)O
Synonyms:- D-Mannitol, ester with boric acid (H3BO3)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
