CAS 6844-58-2
:3,5-diamino-1H-pyrazole-4-carbonitrile
Description:
3,5-Diamino-1H-pyrazole-4-carbonitrile, with the CAS number 6844-58-2, is an organic compound characterized by its pyrazole ring structure, which features two amino groups at the 3 and 5 positions and a cyano group at the 4 position. This compound is typically a solid at room temperature and is known for its potential applications in various fields, including pharmaceuticals and agrochemicals. The presence of amino groups contributes to its reactivity, allowing for further chemical modifications and interactions. The cyano group enhances its utility in synthetic chemistry, as it can participate in nucleophilic reactions. Additionally, 3,5-diamino-1H-pyrazole-4-carbonitrile may exhibit biological activity, making it a subject of interest in medicinal chemistry. Its solubility and stability can vary depending on the solvent and environmental conditions, which are important factors to consider in practical applications. Overall, this compound represents a versatile building block in organic synthesis and research.
Formula:C4H5N5
InChI:InChI=1/C4H5N5/c5-1-2-3(6)8-9-4(2)7/h(H5,6,7,8,9)
SMILES:C(#N)c1c(N)[nH][nH]c1=N
Synonyms:- 1H-pyrazole-4-carbonitrile, 3,5-diamino-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1H-Pyrazole-4-carbonitrile, 3,5-diamino-
CAS:Formula:C4H5N5Purity:95%Color and Shape:SolidMolecular weight:123.11603,5-Diamino-1H-pyrazole-4-carbonitrile
CAS:3,5-Diamino-1H-pyrazole-4-carbonitrilePurity:96%Molecular weight:123.12g/mol3,5-Diamino-1H-pyrazole-4-carbonitrile
CAS:Formula:C4H5N5Purity:98%Color and Shape:Solid, Grey powderMolecular weight:123.1193,5-Diamino-1H-pyrazole-4-carbonitrile
CAS:<p>3,5-Diamino-1H-pyrazole-4-carbonitrile is a bioactive molecule that has been shown to have a range of bioactivities. This compound has been shown to be cytotoxic in human lung cancer cells and also inhibits the proliferation of human breast cancer cells. It has also been shown to inhibit the production of nitric oxide by lipopolysaccharide (LPS)-stimulated macrophages. The effects of 3,5-diamino-1H-pyrazole-4-carbonitrile on LPS stimulated macrophage nitric oxide production are due to its ability to inhibit protein synthesis, leading to reduced levels of the enzyme nitric oxide synthase.</p>Formula:C4H5N5Purity:Min. 95%Molecular weight:123.12 g/mol



