CAS 68449-30-9

5-Bromo-1-tetralone

Description:

5-Bromo-1-tetralone is an organic compound characterized by its structure, which includes a bromine atom and a ketone functional group attached to a tetralone framework. The molecular formula typically reflects the presence of carbon, hydrogen, and bromine atoms, indicating its classification as a halogenated aromatic compound. This substance is known for its potential applications in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. The bromine substituent can enhance reactivity, making it useful in various chemical reactions, such as nucleophilic substitutions or coupling reactions. Additionally, the presence of the ketone group contributes to its reactivity and can influence its physical properties, such as solubility and boiling point. As with many brominated compounds, 5-Bromo-1-tetralone may exhibit specific biological activities, which can be of interest in medicinal chemistry. Safety and handling precautions are essential due to the potential hazards associated with brominated compounds, including toxicity and environmental impact.

Formula: C₁₀H₉BrO

InChI: InChI=1/C10H9BrO/c11-9-5-1-4-8-7(9)3-2-6-10(8)12/h1,4-5H,2-3,6H2

SMILES: c1cc2c(CCCC2=O)c(c1)Br

Synonyms:

• 5-Bromo-3,4-dihydro-2H-naphthalen-1-one
• 5-bromo-3,4-dihydronaphthalen-1(2H)-one

1(2H)-Naphthalenone, 5-bromo-3,4-dihydro-

CAS: 68449-30-9

Formula: C₁₀H₉BrO

Purity: 98%

Color and Shape: Solid

Molecular weight: 225.0819

Ref: IN-DA00IBU6

5-Bromo-3,4-dihydronaphthalen-1(2H)-one

CAS: 68449-30-9

5-Bromo-3,4-dihydronaphthalen-1(2H)-one

Formula: C₁₀H₉BrO

Purity: 97%

Color and Shape: white crystalline powder

Molecular weight: 225.08g/mol

Ref: 54-OR14757

5-Bromo-3,4-dihydronaphthalen-1(2H)-one

CAS: 68449-30-9

Formula: C₁₀H₉BrO

Purity: 98%

Color and Shape: Solid

Molecular weight: 225.085

Ref: 10-F092279