
CAS 68478-46-6
:Boron, (benzenemethanamine)trifluoro-, (T-4)-, reaction products with Bu glycidyl ether
Description:
The chemical substance known as "Boron, (benzenemethanamine)trifluoro-, (T-4)-, reaction products with Bu glycidyl ether," with CAS number 68478-46-6, is a complex organoboron compound. It typically features a boron atom coordinated with a trifluoromethyl group and an amine moiety derived from benzenemethanamine, indicating potential applications in organic synthesis and materials science. The presence of the glycidyl ether suggests reactivity that may facilitate cross-linking or polymerization processes, making it useful in the formulation of resins or coatings. This compound may exhibit unique properties such as enhanced thermal stability, chemical resistance, and potential catalytic activity due to the boron center. Additionally, the trifluoromethyl group can impart hydrophobic characteristics and influence the electronic properties of the molecule. Safety and handling considerations are essential, as organoboron compounds can be reactive and may pose health risks if not managed properly. Overall, this substance represents a versatile class of materials with potential applications in various fields, including pharmaceuticals, agrochemicals, and advanced materials.
Formula:C7H14O2·C7H9BF3N
InChI:InChI=1S/C7H9BF3N.C7H14O2/c9-8(10,11)12-6-7-4-2-1-3-5-7;1-2-3-4-8-5-7-6-9-7/h1-5H,6,12H2;7H,2-6H2,1H3
InChI key:InChIKey=DXLYLNHWMHJZNA-UHFFFAOYSA-N
SMILES:C(OCCCC)C1CO1.C([NH2][B+3]([F-])([F-])[F-])C1=CC=CC=C1
Synonyms:- Boron, (benzenemethanamine)trifluoro-, (T-4)-, reaction products with Bu glycidyl ether
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Boron, (benzenemethanamine)trifluoro-, (T-4)-, reaction products with Bu glycidyl ether
CAS:Formula:C14H23BF3NO2Molecular weight:305.1441
