CAS 6848-13-1
:3-Chloro-N,N-dimethylbenzenamine
Description:
3-Chloro-N,N-dimethylbenzenamine, also known as 3-chloro-2-(dimethylamino)aniline, is an organic compound characterized by the presence of a chloro substituent and a dimethylamino group attached to a benzene ring. This compound typically appears as a solid or liquid, depending on its purity and temperature. It is known for its aromatic properties, which contribute to its reactivity and potential applications in various chemical syntheses. The presence of the chloro group enhances its electrophilic character, making it useful in nucleophilic substitution reactions. Additionally, the dimethylamino group can influence the compound's basicity and solubility in different solvents. 3-Chloro-N,N-dimethylbenzenamine is often utilized in the production of dyes, pigments, and pharmaceuticals, owing to its ability to participate in further chemical transformations. Safety precautions are essential when handling this compound, as it may pose health risks, including skin and respiratory irritation. Proper storage and disposal methods should be followed to mitigate environmental impact and ensure safety.
Formula:C8H10ClN
InChI:InChI=1S/C8H10ClN/c1-10(2)8-5-3-4-7(9)6-8/h3-6H,1-2H3
InChI key:InChIKey=CHHCCYVOJBBCIY-UHFFFAOYSA-N
SMILES:N(C)(C)C1=CC(Cl)=CC=C1
Synonyms:- 1-Chloro-3-dimethylaminobenzene
- 3-(N,N-Dimethylamino)-1-chlorobenzene
- 3-Chloro-N,N-dimethylbenzenamine
- 3-Chloro-NN-dimethylaniline
- 3-Dimethylamino-1-chlorobenzene
- Aniline, m-chloro-N,N-dimethyl-
- Benzenamine, 3-chloro-N,N-dimethyl-
- N,N-Dimethyl-3-chloroaniline
- N,N-Dimethyl-m-chloroaniline
- m-Chloro-N,N-dimethylaniline
- 3-Chloro-N,N-dimethylaniline
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
3-Chloro-N,N-dimethylaniline, 95%
CAS:It can be used to produce 3-(3-dimethylamino-phenyl)-acrylic acid butyl ester at the temperature of 140C in the presence of reagent Na2CO3 and solvent N,N-dimethyl-acetamide with the reaction time of 20 hours. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar produFormula:C8H10ClNPurity:95%Color and Shape:Liquid, Clear colorless to yellow to orange or pale brownMolecular weight:155.633-Chloro-N,N-dimethylaniline
CAS:Formula:C8H10ClNPurity:95%Color and Shape:LiquidMolecular weight:155.6247N1,N1-dimethyl-3-chloroaniline
CAS:N1,N1-dimethyl-3-chloroanilinePurity:95%Molecular weight:155.62g/mol3-Chloro-N,N-dimethylaniline
CAS:Formula:C8H10ClNPurity:>97.0%(GC)(T)Color and Shape:Light yellow to Brown clear liquidMolecular weight:155.633-Chloro-N,N-dimethylaniline
CAS:Formula:C8H10ClNPurity:95%(GC-MS);RGColor and Shape:LiquidMolecular weight:155.63




