CAS 68480-20-6

1-(2,2-Dimethoxyethoxy)decane

Description:

1-(2,2-Dimethoxyethoxy)decane, with the CAS number 68480-20-6, is an organic compound characterized by its long hydrocarbon chain and ether functional groups. This substance features a decane backbone, which consists of ten carbon atoms, providing it with hydrophobic properties. The presence of the 2,2-dimethoxyethoxy group introduces two methoxy (-OCH3) groups, enhancing its solubility in organic solvents while maintaining some degree of hydrophilicity due to the ether linkages. This compound is likely to exhibit low volatility and moderate viscosity, typical of long-chain aliphatic compounds. Its structure suggests potential applications in surfactants, emulsifiers, or as a solvent in various chemical processes. Additionally, the presence of ether groups may impart stability and resistance to hydrolysis, making it suitable for use in formulations requiring longevity and effectiveness under varying conditions. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance.

Formula: C₁₄H₃₀O₃

InChI: InChI=1S/C14H30O3/c1-4-5-6-7-8-9-10-11-12-17-13-14(15-2)16-3/h14H,4-13H2,1-3H3

InChI key: InChIKey=QZLXMANORVOJAO-UHFFFAOYSA-N

SMILES: C(COCCCCCCCCCC)(OC)OC

Synonyms:

• 1-(2,2-Dimethoxyethoxy)decane
• Decane, 1-(2,2-dimethoxyethoxy)-

Decane, 1-(2,2-dimethoxyethoxy)-

CAS: 68480-20-6

Decane, 1-(2,2-dimethoxyethoxy)- is a biochemical.

Formula: C₁₄H₃₀O₃

Color and Shape: Solid

Molecular weight: 246.39

Ref: TM-T31313