CAS 68480-22-8
:m-isopropylphenethyl alcohol
Description:
m-Isopropylphenethyl alcohol, with the CAS number 68480-22-8, is an organic compound characterized by its structure, which features a phenethyl group substituted with an isopropyl group at the meta position. This compound typically exhibits a colorless to pale yellow liquid form and possesses a pleasant, floral-like odor, making it of interest in the fragrance and flavor industries. It is moderately soluble in water and more soluble in organic solvents, reflecting its amphiphilic nature. The compound's chemical properties include the presence of hydroxyl (-OH) functional groups, which contribute to its reactivity and potential for hydrogen bonding. m-Isopropylphenethyl alcohol may also exhibit biological activity, although specific pharmacological effects would require further investigation. Safety data should be consulted to understand its handling and potential hazards, as with any chemical substance. Overall, m-isopropylphenethyl alcohol is valued for its aromatic properties and versatility in various applications.
Formula:C11H16O
InChI:InChI=1/C11H16O/c1-9(2)11-5-3-4-10(8-11)6-7-12/h3-5,8-9,12H,6-7H2,1-2H3
InChI key:InChIKey=ZNRBQJLZGSDXDM-UHFFFAOYSA-N
SMILES:C(CO)C1=CC(C(C)C)=CC=C1
Synonyms:- 2-[3-(Propan-2-Yl)Phenyl]Ethanol
- 2-[3-(Propan-2-yl)phenyl]ethan-1-ol
- 3-(1-Methylethyl)benzeneethanol
- 3-Iso-Propylphenethyl alcohol
- 3-Isopropyl-phenethyl alcohol
- Benzeneethanol, 3-(1-methylethyl)-
- Phenethyl alcohol, m-isopropyl-
- m-Isopropylphenethyl alcohol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Benzeneethanol, 3-(1-methylethyl)-
CAS:Benzeneethanol, 3-(1-methylethyl)- is a bioactive chemical.Formula:C11H16OColor and Shape:SolidMolecular weight:164.24
