CAS 68489-09-8
:(1R,2S,5R)-N-(4-Methoxyphenyl)-5-methyl-2-(1-methylethyl)cyclohexanecarboxamide
Description:
The chemical substance known as (1R,2S,5R)-N-(4-Methoxyphenyl)-5-methyl-2-(1-methylethyl)cyclohexanecarboxamide, with the CAS number 68489-09-8, is a synthetic organic compound characterized by its complex cyclohexane structure. This compound features a cyclohexanecarboxamide backbone, which is substituted with a methoxyphenyl group and an isopropyl group, contributing to its unique three-dimensional conformation and potential biological activity. The presence of multiple chiral centers indicates that it may exhibit stereoisomerism, which can influence its pharmacological properties. Typically, compounds of this nature are investigated for their potential therapeutic applications, particularly in the fields of medicinal chemistry and drug development. The methoxy group enhances lipophilicity, potentially affecting the compound's solubility and permeability. Additionally, the structural features suggest that it may interact with specific biological targets, making it of interest for further research in pharmacodynamics and pharmacokinetics. Overall, this compound exemplifies the complexity and diversity of synthetic organic molecules used in various scientific applications.
Formula:C18H27NO2
InChI:InChI=1S/C18H27NO2/c1-12(2)16-10-5-13(3)11-17(16)18(20)19-14-6-8-15(21-4)9-7-14/h6-9,12-13,16-17H,5,10-11H2,1-4H3,(H,19,20)/t13-,16+,17-/m1/s1
InChI key:InChIKey=HNSGVPAAXJJOPQ-XOKHGSTOSA-N
SMILES:C(NC1=CC=C(OC)C=C1)(=O)[C@H]2[C@H]([C@@H](C)C)CC[C@@H](C)C2
Synonyms:- (1R,2S,5R)-N-(4-Methoxyphenyl)-5-Methyl-2-Propan-2-Ylcyclohexane-1-Carboxamide
- (1R,2S,5R)-N-(4-Methoxyphenyl)-5-methyl-2-(1-methylethyl)cyclohexanecarboxamide
- Cyclohexanecarboxamide, N-(4-methoxyphenyl)-5-methyl-2-(1-methylethyl)-, [1R-(1α,2β,5α)]-
- Fema 4681
- Ws 12
- [1R,2S,5R]-N-(4-Methoxyphenyl)-p-menthanecarboxamide
- Cyclohexanecarboxamide, N-(4-methoxyphenyl)-5-methyl-2-(1-methylethyl)-, (1R,2S,5R)-
- N-(4-Methoxyphenyl)-p-menthane-3-carboxamide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
Cyclohexanecarboxamide,N-(4-methoxyphenyl)-5-methyl-2-(1-methylethyl)-, (1R,2S,5R)-
CAS:Formula:C18H27NO2Purity:98%Color and Shape:SolidMolecular weight:289.4125WS-12
CAS:WS-12 is a potent TRPM8 agonist that acts as a cooling agent (EC50 : 193 nM)Formula:C18H27NO2Purity:99.99%Color and Shape:Whitish To White Solid CrystallineMolecular weight:289.41WS-12
CAS:<p>WS-12 is a low-potency antimicrobial agent that inhibits bacterial growth by disrupting the microbial membrane and cell wall. WS-12 is an aryl halide with a cationic side chain that binds to activated filaments, which disrupts the function of the cell membrane. The exact mechanism of how WS-12 interacts with cells is not known, but it has been shown to alter neuronal function, cause growth inhibition in cancer cells, and inhibit the polymerase chain reaction.</p>Formula:C18H27NO2Purity:Min. 95%Molecular weight:289.41 g/mol





