CAS 685-27-8
:N-Methylbis(trifluoroacetyl)imide
Description:
N-Methylbis(trifluoroacetyl)imide, with the CAS number 685-27-8, is an organic compound characterized by its imide functional group and the presence of trifluoroacetyl groups. This substance typically appears as a colorless to pale yellow liquid or solid, depending on its purity and temperature. It is known for its high thermal stability and low volatility, making it suitable for various applications in organic synthesis and as a reagent in chemical reactions. The trifluoroacetyl groups contribute to its strong electron-withdrawing properties, enhancing its reactivity in nucleophilic substitution reactions. Additionally, N-Methylbis(trifluoroacetyl)imide is soluble in polar organic solvents, which facilitates its use in diverse chemical environments. Due to the presence of fluorine atoms, it exhibits unique properties such as increased lipophilicity and potential bioactivity. Safety precautions should be taken when handling this compound, as it may pose health risks if inhaled or ingested, and appropriate protective equipment should be used to mitigate exposure.
Formula:C5H3F6NO2
InChI:InChI=1S/C5H3F6NO2/c1-12(2(13)4(6,7)8)3(14)5(9,10)11/h1H3
InChI key:InChIKey=AWGBWLXGUPTXHF-UHFFFAOYSA-N
SMILES:C(N(C(C(F)(F)F)=O)C)(C(F)(F)F)=O
Synonyms:- 2,2,2-Trifluoro-N-methyl-N-(2,2,2-trifluoroacetyl)acetamide
- 2,2,2-trifluoro-N-methyl-N-(trifluoroacetyl)acetamide
- Acetamide, 2,2,2-trifluoro-N-methyl-N-(2,2,2-trifluoroacetyl)-
- Acetamide, 2,2,2-trifluoro-N-methyl-N-(trifluoroacetyl)-
- Diacetamide, 2,2,2,2′,2′,2′-hexafluoro-N-methyl-
- Mbtfa
- N-Methylbis(trifluoroacetamide)
- N-Methylbis(trifluoroacetyl)imide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
N-Methylbis(trifluoroacetamide) [Trifluoroacylating Agent]
CAS:Formula:C5H3F6NO2Purity:>97.0%(GC)Color and Shape:Colorless to Light yellow clear liquidMolecular weight:223.07N-Methylbis(trifluoroacetamide)
CAS:N-Methylbis(trifluoroacetamide)Formula:C5H3F6NO2Purity:94%Color and Shape: clear. colourless liquidMolecular weight:223.07g/molN-Methyl-bis(trifluoroacetamide)
CAS:Formula:C5H3F6NO2Purity:≥ 95.0%Color and Shape:Clear, colourless liquidMolecular weight:223.07N-Methylbis(trifluoroacetamide)
CAS:N-Methylbis(trifluoroacetamide)Purity:98%Color and Shape:Colourless LiquidMolecular weight:223.07g/molN-Methyl-bis-trifluoroacetamide
CAS:S11048 - N-Methyl-bis-trifluoroacetamide
Formula:C5H3F6NO2Purity:96%Color and Shape:LiquidMolecular weight:223.074N-Methylbis(trifluoroacetamide)
CAS:N-Methylbis(trifluoroacetamide) is a molecule that is used in the preparation of an analytical method. This molecule reacts with human serum and urine to produce a reaction solution. The matrix effect can be seen in metabolic disorders, such as the case of creatine kinase which is not affected by the derivatization. N-Methylbis(trifluoroacetamide) is also used to prepare samples for solid phase microextraction with basic structures that are amines.Formula:C5H3F6NO2Purity:Min. 95%Color and Shape:Clear LiquidMolecular weight:223.07 g/molN-Methyl-bis(trifluoroacetamide)
CAS:Formula:C5H3F6NO2Purity:98%Color and Shape:LiquidMolecular weight:223.0732





