CAS 6850-35-7
:3-Methylcyclohexanamine
Description:
3-Methylcyclohexanamine, with the CAS number 6850-35-7, is an organic compound characterized by its cyclohexane ring structure with a methyl group and an amine functional group. This compound is a derivative of cyclohexanamine, where a methyl group is attached to the third carbon of the cyclohexane ring. It is typically a colorless to pale yellow liquid or solid, depending on its purity and temperature. The presence of the amine group imparts basic properties to the molecule, allowing it to participate in various chemical reactions, including nucleophilic substitutions and condensation reactions. 3-Methylcyclohexanamine is often used in the synthesis of pharmaceuticals, agrochemicals, and other organic compounds. Its physical properties, such as boiling point and solubility, can vary based on the specific isomer and conditions. Safety data indicates that, like many amines, it may be irritating to the skin and eyes, and appropriate handling precautions should be observed.
Formula:C7H15N
InChI:InChI=1S/C7H15N/c1-6-3-2-4-7(8)5-6/h6-7H,2-5,8H2,1H3
InChI key:InChIKey=JYDYHSHPBDZRPU-UHFFFAOYSA-N
SMILES:CC1CC(N)CCC1
Synonyms:- 1,3-Aminomethylcyclohexane
- 3-Methylcyclohexan-1-amine
- 3-Methylcyclohexanamine
- 3-Methylcyclohexylamine
- Cyclohexanamine, 3-methyl-
- Cyclohexylamine, 3-methyl-
- m-Methylcyclohexylamine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
3-Methylcyclohexylamine (cis- and trans- mixture)
CAS:Formula:C7H15NPurity:>98.0%(GC)(T)Color and Shape:Colorless to Almost colorless clear liquidMolecular weight:113.203-Methylcyclohexylamine
CAS:3-MethylcyclohexylamineFormula:C7H15NPurity:97%Color and Shape: colourless liquidMolecular weight:113.20g/mol3-Methylcyclohexylamine
CAS:3-Methylcyclohexylamine is a chemical compound that has not been extensively studied in vivo or in vitro. It has been shown to be a substrate for the enzyme tyrosine kinase, which regulates cell growth and differentiation, and can be used as a ligand for palladium complexes. 3-Methylcyclohexylamine has a hydroxyl group that reacts with amines to form secondary amines. 3-Methylcyclohexylamine also possesses two functional groups (a carbonyl group and an amine), which may allow it to act as a coenzyme in the synthesis of spermine from spermidine.
Formula:C7H15NPurity:Min. 95%Color and Shape:Clear LiquidMolecular weight:113.2 g/mol




