CAS 6850-38-0

Aminocyclohexanol

Description:

Aminocyclohexanol, with the CAS number 6850-38-0, is an organic compound characterized by the presence of both an amino group and a hydroxyl group attached to a cyclohexane ring. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its specific form and purity. It is known for its potential applications in the synthesis of pharmaceuticals, agrochemicals, and as a building block in organic chemistry. The amino group imparts basic properties, while the hydroxyl group contributes to its ability to engage in hydrogen bonding, affecting its solubility in polar solvents. Aminocyclohexanol can participate in various chemical reactions, including nucleophilic substitutions and condensation reactions, making it a versatile intermediate in organic synthesis. Additionally, its structural features allow for the exploration of stereochemistry, as the cyclohexane ring can adopt different conformations, influencing the reactivity and interactions of the compound in various chemical environments.

Formula: C₆H₁₃NO

InChI: InChI=1/C6H13NO/c7-5-3-1-2-4-6(5)8/h5-6,8H,1-4,7H2

SMILES: C1CCC(C(C1)N)O

Synonyms:

• 2-Aminocyclohexanol

2-Aminocyclohexanol (cis- and trans- mixture)

CAS: 6850-38-0

Formula: C₆H₁₃NO

Purity: >98.0%(GC)(T)

Color and Shape: White to Light orange to Yellow powder to crystal

Molecular weight: 115.18

Ref: 3B-A1258

2-Aminocyclohexanol

CAS: 6850-38-0

Formula: C₆H₁₃NO

Purity: 98%

Color and Shape: Solid

Molecular weight: 115.1735

Ref: IN-DA003346

2-Aminocyclohexan-1-ol

CAS: 6850-38-0

2-Aminocyclohexan-1-ol

Formula: C₆H₁₃NO

Purity: 98%

Color and Shape: white solid

Molecular weight: 115.17g/mol

Ref: 54-OR21260

2-Aminocyclohexanol

CAS: 6850-38-0

Formula: C₆H₁₃NO

Purity: 97%

Color and Shape: Solid, Powder or Crystalline Powder or Solid

Molecular weight: 115.176

Ref: 10-F103700