CAS 6850-40-4
:2-Propylcyclohexanamine
Description:
2-Propylcyclohexanamine, with the CAS number 6850-40-4, is an organic compound characterized by its cyclohexane ring structure substituted with an amine group and a propyl group. This compound typically exhibits a colorless to pale yellow liquid form and has a distinct amine odor. It is classified as an aliphatic amine, which suggests it may participate in various chemical reactions, including nucleophilic substitutions and hydrogen bonding due to the presence of the amine functional group. The presence of the propyl group influences its hydrophobic characteristics, potentially affecting its solubility in water and organic solvents. Additionally, 2-Propylcyclohexanamine may have applications in the synthesis of pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis. Safety data indicates that, like many amines, it may be irritating to the skin and eyes, and appropriate handling precautions should be observed. Overall, its unique structure and properties make it a compound of interest in various chemical applications.
Formula:C9H19N
InChI:InChI=1S/C9H19N/c1-2-5-8-6-3-4-7-9(8)10/h8-9H,2-7,10H2,1H3
InChI key:InChIKey=DWVNXHKKIRXAOL-UHFFFAOYSA-N
SMILES:C(CC)C1C(N)CCCC1
Synonyms:- Cyclohexylamine, 2-propyl-
- 2-Propylcyclohexylamine
- 2-Propylcyclohexanamine
- Cyclohexanamine, 2-propyl-
- 2-Propylcyclohexan-1-amine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
2-Propylcyclohexan-1-amine
CAS:2-Propylcyclohexan-1-amine is a hydrogenation reaction intermediate that is produced by the thermodynamic equilibrium of cyclohexanone. It is a colorless liquid that has an amine odor. 2-Propylcyclohexan-1-amine can be used as a solvent and as a reactant in industrial processes. The phosphide ion, P, in this compound can be oxidized to form phosphoric acid with heat or light. This reaction has an activation energy (Ea) of 78 kJ/mol and produces hydrogen gas and the corresponding acid from 2-propyclohexanone. The bond cleavage reaction between phosphine and cyclohexane has an Ea of 54 kJ/mol and produces hydrogen gas, phosphate ions, and the corresponding alcohol.
Formula:C9H19NPurity:Min. 95%Molecular weight:141.25 g/molRef: 3D-GAA85040
Discontinued product
