CAS 68500-37-8

4-Chloro-7-methoxyquinoline

Description:

4-Chloro-7-methoxyquinoline is an organic compound characterized by its quinoline structure, which consists of a fused benzene and pyridine ring. The presence of a chlorine atom at the 4-position and a methoxy group at the 7-position contributes to its unique chemical properties. This compound typically appears as a solid and is known for its potential biological activities, including antimicrobial and antitumor properties. Its molecular formula reflects the presence of chlorine, oxygen, and nitrogen, which influence its reactivity and solubility in various solvents. The compound's structure allows for various substitution reactions, making it a valuable intermediate in organic synthesis. Additionally, 4-Chloro-7-methoxyquinoline may exhibit fluorescence, which can be useful in analytical applications. Safety data indicates that, like many chemical substances, it should be handled with care, following appropriate safety protocols to mitigate any potential hazards associated with its use.

Formula: C₁₀H₈ClNO

InChI: InChI=1/C10H8ClNO/c1-13-7-2-3-8-9(11)4-5-12-10(8)6-7/h2-6H,1H3

SMILES: COc1ccc2c(ccnc2c1)Cl

Synonyms:

• 7-Methoxy-4-chloroquinoline

4-chloro-7-methoxyquinoline

CAS: 68500-37-8

Formula: C₁₀H₈ClNO

Purity: 97%

Color and Shape: Solid

Molecular weight: 193.6296

Ref: IN-DA003L60

4-Chloro-7-methoxyquinoline

CAS: 68500-37-8

4-Chloro-7-methoxyquinoline

Formula: C₁₀H₈ClNO

Purity: ≥95%

Color and Shape: off-white to light yellow solid

Molecular weight: 193.63g/mol

Ref: 54-OR8277

4-Chloro-7-methoxy-quinoline

CAS: 68500-37-8

Formula: C₁₀H₈ClNO

Purity: 97%

Color and Shape: Solid

Molecular weight: 193.63

Ref: 10-F040473