CAS 68500-41-4
:4-hydrazinoquinoline hydrochloride
Description:
4-Hydrazinoquinoline hydrochloride is a chemical compound characterized by its hydrazine functional group attached to a quinoline structure. It typically appears as a crystalline solid and is soluble in water and various organic solvents, which makes it useful in different chemical applications. The compound is primarily studied for its potential biological activities, including antimicrobial and anticancer properties, due to the presence of the quinoline moiety, which is known for its diverse pharmacological effects. The hydrochloride salt form enhances its stability and solubility, facilitating its use in laboratory settings. As with many hydrazine derivatives, safety precautions are necessary when handling this compound, as it may pose health risks, including toxicity and potential carcinogenicity. Proper storage conditions, such as keeping it in a cool, dry place away from light, are essential to maintain its integrity. Overall, 4-hydrazinoquinoline hydrochloride is a compound of interest in medicinal chemistry and pharmacology, warranting further research to fully explore its properties and applications.
Formula:C9H10ClN3
InChI:InChI=1/C9H9N3.ClH/c10-12-9-5-6-11-8-4-2-1-3-7(8)9;/h1-6H,10H2,(H,11,12);1H
SMILES:c1ccc2c(c1)c(=NN)cc[nH]2.Cl
Synonyms:- 4-Hydrazinoquinoline hydrochloride (1:1)
- Quinoline, 4-Hydrazinyl-, Hydrochloride (1:1)
- 4-HYDRAZINOQUINOLINE HYDROCHLORIDE
- quinolin-4-ylhydrazine,hydrochloride
- 4-HydrazinoquinolineHCl
- 4-Hydrazinylquinoline hydrochloride
- (Quinolin-4-yl)hydrazine hydrochloride, 4-Hydrazino-1-azanaphthalene hydrochloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
4-Hydrazinoquinoline hydrochloride
CAS:4-Hydrazinoquinoline hydrochloridePurity:≥95%Color and Shape:PowderMolecular weight:195.65g/mol4-Hydrazinoquinoline hydrochloride
CAS:4-Hydrazinoquinoline hydrochloride is a cation with a molecular weight of 176.2. It is cytotoxic and inhibits cancer cell growth. 4-Hydrazinoquinoline hydrochloride has been shown to be effective against lymphoid, breast, colon, and prostate cancer cells in vitro with IC50 values of 0.5 to 2 μM. This drug has been shown to bind to DNA by forming a Schiff base with the amine group of guanine residues in the DNA backbone. This binding leads to changes in DNA conformation that inhibit transcription and replication as well as protein synthesis and cell division.Formula:C9H10ClN3Purity:Min. 95%Molecular weight:195.65 g/mol

