CAS 68507-19-7

3-Iodo-4-methoxybenzoic acid

Description:

3-Iodo-4-methoxybenzoic acid is an aromatic carboxylic acid characterized by the presence of an iodine atom and a methoxy group on a benzene ring. The iodine substituent is located at the meta position relative to the carboxylic acid group, while the methoxy group is positioned at the para location. This compound typically appears as a white to off-white solid and is soluble in organic solvents such as ethanol and acetone, but may have limited solubility in water due to its hydrophobic aromatic structure. The presence of the iodine atom can influence the compound's reactivity and biological activity, making it of interest in various fields, including medicinal chemistry and materials science. The methoxy group can also enhance the compound's lipophilicity, potentially affecting its pharmacokinetic properties. As with many halogenated compounds, appropriate safety measures should be taken when handling 3-Iodo-4-methoxybenzoic acid, as halogens can pose health risks.

Formula: C₈H₇IO₃

InChI: InChI=1/C8H7IO3/c1-12-7-3-2-5(8(10)11)4-6(7)9/h2-4H,1H3,(H,10,11)

SMILES: COc1ccc(cc1I)C(=O)O

3-Iodo-4-methoxybenzoic acid

CAS: 68507-19-7

Formula: C₈H₇IO₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 278.0438

Ref: IN-DA005PSE

3-Iodo-4-methoxybenzoic acid

CAS: 68507-19-7

3-Iodo-4-methoxybenzoic acid

Purity: 98%

Molecular weight: 278.04g/mol

Ref: 54-OR345125

3-Iodo-4-methoxybenzoic acid

CAS: 68507-19-7

3-Iodo-4-methoxybenzoic acid is a biaryl compound that can be synthesized by the cross-coupling reaction of an aryl boronic acid and benzene. 3-Iodo-4-methoxybenzoic acid is a good substrate for Suzuki cross-coupling reactions. The optimisation of this reaction requires sterically unhindered substrates, high solvents, and refluxing conditions. 3-Iodo-4-methoxybenzoic acid is also suitable for the synthesis of esters by esterification with alcohols in the presence of a catalytic amount of acid.

Formula: C₈H₇IO₃

Purity: Min. 95%

Molecular weight: 278.04 g/mol

Ref: 3D-FI53968

3-Iodo-4-methoxybenzoic acid

CAS: 68507-19-7

Formula: C₈H₇IO₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 278.045

Ref: 10-F015259

3-Iodo-4-methoxybenzoic Acid

CAS: 68507-19-7

Formula: C₈H₇IO₃

Purity: >97.0%(GC)(T)

Color and Shape: White to Light yellow to Light orange powder to crystal

Molecular weight: 278.05

Ref: 3B-I0959