CAS 685103-95-1
:2-Hydroxy-5-iodo-benzonitrile
Description:
2-Hydroxy-5-iodo-benzonitrile is an organic compound characterized by the presence of a hydroxyl group (-OH), an iodine atom, and a nitrile group (-C≡N) attached to a benzene ring. This compound features a phenolic structure due to the hydroxyl group, which can influence its reactivity and solubility. The iodine substituent at the 5-position enhances the compound's electrophilic character, making it potentially useful in various chemical reactions, including nucleophilic substitutions. The nitrile group contributes to the compound's polarity and can participate in further chemical transformations. 2-Hydroxy-5-iodo-benzonitrile may exhibit biological activity, making it of interest in medicinal chemistry and material science. Its properties, such as melting point, boiling point, and solubility, can vary based on the specific conditions and solvents used. As with many halogenated compounds, safety precautions should be taken when handling this substance due to potential toxicity and environmental impact.
Formula:C7H4INO
InChI:InChI=1S/C7H4INO/c8-6-1-2-7(10)5(3-6)4-9/h1-3,10H
SMILES:c1cc(c(cc1I)C#N)O
Synonyms:- 2-Hydroxy-5-Iodobenzonitrile
- 5-Iodo-2-Hydroxybenzonitrile
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-Hydroxy-5-Iodo-Benzonitrile
CAS:Formula:C7H4INOPurity:95%Color and Shape:SolidMolecular weight:245.01722-Hydroxy-5-iodobenzonitrile
CAS:2-Hydroxy-5-iodobenzonitrile is an analog of pyochelin that inhibits the growth of pathogenic bacteria. It binds to the siderophore receptor, which is found on bacterial cells and is responsible for binding to ferric iron. This prevents the uptake of ferric iron into the cell and disrupts metabolic processes, leading to cell death. 2-Hydroxy-5-iodobenzonitrile has been shown to be active against Pseudomonas aeruginosa, Burkholderia cepacia, and Pseudomonas species. Although it does not possess a functionalized group like other analogs, it is still able to bind to these receptors with high affinity.Formula:C7H4INOPurity:90%Color and Shape:PowderMolecular weight:245.02 g/mol2-Hydroxy-5-iodo-benzonitrile
CAS:Formula:C7H4INOPurity:97%Color and Shape:SolidMolecular weight:245.019



